Difference between revisions of "S2O3"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIACYLGLYCEROL DIACYLGLYCEROL] == * common name: ** a 1,2-diacyl-sn-glycerol * Synonym(s): ** a...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC GLC] == * smiles: ** C(O)C1(OC(O)C(O)C(O)C(O)1) * inchi key: ** InChIKey=WQZGKKKJIJFFOK-VFU...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC GLC] == |
+ | * smiles: | ||
+ | ** C(O)C1(OC(O)C(O)C(O)C(O)1) | ||
+ | * inchi key: | ||
+ | ** InChIKey=WQZGKKKJIJFFOK-VFUOTHLCSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** β-D-glucopyranose |
+ | * molecular weight: | ||
+ | ** 180.157 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** β-D-glucose |
− | ** | + | ** β-glucose |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[biomass_rxn]] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[TREHALA-RXN]] |
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[ALDOSE-1-EPIMERASE-RXN]] |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 50-99-7 |
− | {{#set: common name= | + | * BIGG : 33582 |
− | {{#set: | + | * DRUGBANK : DB02379 |
− | {{#set: produced by= | + | * PUBCHEM: |
− | {{#set: reversible reaction associated= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=64689 64689] |
+ | * HMDB : HMDB00516 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00221 C00221] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.18802415.html 18802415] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15903 15903] | ||
+ | * METABOLIGHTS : MTBLC15903 | ||
+ | {{#set: smiles=C(O)C1(OC(O)C(O)C(O)C(O)1)}} | ||
+ | {{#set: inchi key=InChIKey=WQZGKKKJIJFFOK-VFUOTHLCSA-N}} | ||
+ | {{#set: common name=β-D-glucopyranose}} | ||
+ | {{#set: molecular weight=180.157 }} | ||
+ | {{#set: common name=β-D-glucose|β-glucose}} | ||
+ | {{#set: consumed by=biomass_rxn}} | ||
+ | {{#set: produced by=TREHALA-RXN}} | ||
+ | {{#set: reversible reaction associated=ALDOSE-1-EPIMERASE-RXN}} |
Revision as of 13:26, 21 March 2018
Contents
Metabolite GLC
- smiles:
- C(O)C1(OC(O)C(O)C(O)C(O)1)
- inchi key:
- InChIKey=WQZGKKKJIJFFOK-VFUOTHLCSA-N
- common name:
- β-D-glucopyranose
- molecular weight:
- 180.157
- Synonym(s):
- β-D-glucose
- β-glucose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 50-99-7
- BIGG : 33582
- DRUGBANK : DB02379
- PUBCHEM:
- HMDB : HMDB00516
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC15903