Difference between revisions of "RXN-9531"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYXYLULOSE-5P DEOXYXYLULOSE-5P] == * smiles: ** CC(=O)C(O)C(O)COP([O-])(=O)[O-] * inchi key:...") |
(Created page with "Category:Gene == Gene Ec-01_008520 == * left end position: ** 7234091 * transcription direction: ** NEGATIVE * right end position: ** 7243130 * centisome position: ** 70.1...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_008520 == |
− | * | + | * left end position: |
− | ** | + | ** 7234091 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 7243130 |
− | * | + | * centisome position: |
− | ** | + | ** 70.105705 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0002_0003 |
− | ** | + | ** Esi0002_0003 |
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[TRNA-GUANINE-N7--METHYLTRANSFERASE-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | + | *** Assignment: ec-number | |
− | * [[ | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: left end position=7234091}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=7243130}} | |
− | + | {{#set: centisome position=70.105705 }} | |
− | + | {{#set: common name=Esi_0002_0003|Esi0002_0003}} | |
− | + | {{#set: reaction associated=TRNA-GUANINE-N7--METHYLTRANSFERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Revision as of 14:27, 21 March 2018
Gene Ec-01_008520
- left end position:
- 7234091
- transcription direction:
- NEGATIVE
- right end position:
- 7243130
- centisome position:
- 70.105705
- Synonym(s):
- Esi_0002_0003
- Esi0002_0003
Reactions associated
- Reaction: TRNA-GUANINE-N7--METHYLTRANSFERASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome