Difference between revisions of "CPD-10330"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-85 CPD-85] == * smiles: ** CSCCC(C([O-])=CO)=O * inchi key: ** InChIKey=CILXJJLQPTUUSS-XQRV...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10330 CPD-10330] == * smiles: ** C(C1(C(C(C(O1)O)O)O))O * inchi key: ** InChIKey=HMFHBZSHGG...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10330 CPD-10330] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(C1(C(C(C(O1)O)O)O))O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N |
* common name: | * common name: | ||
− | ** | + | ** α-D-ribofuranose |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 150.131 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** α D-ribose |
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RIBOKIN-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-14904]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=445894 445894] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.5575.html 5575] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=45506 45506] |
− | + | * HMDB : HMDB00283 | |
− | + | {{#set: smiles=C(C1(C(C(C(O1)O)O)O))O}} | |
− | * HMDB : | + | {{#set: inchi key=InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N}} |
− | {{#set: smiles= | + | {{#set: common name=α-D-ribofuranose}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: molecular weight=150.131 }} |
− | {{#set: common name= | + | {{#set: common name=α D-ribose}} |
− | {{#set: molecular weight= | + | {{#set: consumed by=RIBOKIN-RXN}} |
− | {{#set: common name= | + | {{#set: reversible reaction associated=RXN-14904}} |
− | {{#set: consumed by= | + |
Revision as of 20:23, 17 March 2018
Contents
Metabolite CPD-10330
- smiles:
- C(C1(C(C(C(O1)O)O)O))O
- inchi key:
- InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N
- common name:
- α-D-ribofuranose
- molecular weight:
- 150.131
- Synonym(s):
- α D-ribose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links