Difference between revisions of "CPD0-2352"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15065 RXN-15065] == * direction: ** LEFT-TO-RIGHT * common name: ** phospholipase A2 * ec numbe...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GALACTONO-1-4-LACTONE D-GALACTONO-1-4-LACTONE] == * smiles: ** C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15065 RXN-15065] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GALACTONO-1-4-LACTONE D-GALACTONO-1-4-LACTONE] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)
 +
* inchi key:
 +
** InChIKey=SXZYCXMUPBBULW-AIHAYLRMSA-N
 
* common name:
 
* common name:
** phospholipase A2
+
** D-galactono-1,4-lactone
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/3.1.1.4 EC-3.1.1.4]
+
** 178.141   
 
* Synonym(s):
 
* Synonym(s):
 +
** D-galactonate-γ-lactone
 +
** galactono-γ-lactone
 +
** D-galactonolactone
 +
** D-galactono-γ-lactone
 +
** D-galactonic acid γ-lactone
 +
** γ-D-galactonolactone
 +
** D-(-)-galactonic acid γ-lactone
 +
** D-galactonic acid g-lactone
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[GALACTONOLACTONASE-RXN]]
** 1 [[WATER]][c] '''+''' 1 [[1-2-DIPALMITOYLPHOSPHATIDYLCHOLINE]][c] '''=>''' 1 [[PALMITATE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD-8343]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 H2O[c] '''+''' 1 1,2-dipalmitoyl-phosphatidylcholine[c] '''=>''' 1 palmitate[c] '''+''' 1 H+[c] '''+''' 1 1-16:0-2-lysophosphatidylcholine[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Ec-21_005150]]
+
** ESILICULOSUS_GENOME
+
***GO-TERM
+
* [[Ec-04_004650]]
+
** ESILICULOSUS_GENOME
+
***GO-TERM
+
== Pathways  ==
+
* [[PWY-7416]], phospholipid remodeling (phosphatidylcholine, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7416 PWY-7416]
+
** '''3''' reactions found over '''3''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 2782-07-2
{{#set: common name=phospholipase A2}}
+
* PUBCHEM:
{{#set: ec number=EC-3.1.1.4}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=97165 97165]
{{#set: gene associated=Ec-21_005150|Ec-04_004650}}
+
* HMDB : HMDB02541
{{#set: in pathway=PWY-7416}}
+
* LIGAND-CPD:
{{#set: reconstruction category=annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C03383 C03383]
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
* CHEMSPIDER:
{{#set: reconstruction tool=pathwaytools}}
+
** [http://www.chemspider.com/Chemical-Structure.92162.html 92162]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15895 15895]
 +
{{#set: smiles=C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)}}
 +
{{#set: inchi key=InChIKey=SXZYCXMUPBBULW-AIHAYLRMSA-N}}
 +
{{#set: common name=D-galactono-1,4-lactone}}
 +
{{#set: molecular weight=178.141    }}
 +
{{#set: common name=D-galactonate-γ-lactone|galactono-γ-lactone|D-galactonolactone|D-galactono-γ-lactone|D-galactonic acid γ-lactone|γ-D-galactonolactone|D-(-)-galactonic acid γ-lactone|D-galactonic acid g-lactone}}
 +
{{#set: consumed by=GALACTONOLACTONASE-RXN}}

Revision as of 13:27, 21 March 2018

Metabolite D-GALACTONO-1-4-LACTONE

  • smiles:
    • C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)
  • inchi key:
    • InChIKey=SXZYCXMUPBBULW-AIHAYLRMSA-N
  • common name:
    • D-galactono-1,4-lactone
  • molecular weight:
    • 178.141
  • Synonym(s):
    • D-galactonate-γ-lactone
    • galactono-γ-lactone
    • D-galactonolactone
    • D-galactono-γ-lactone
    • D-galactonic acid γ-lactone
    • γ-D-galactonolactone
    • D-(-)-galactonic acid γ-lactone
    • D-galactonic acid g-lactone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)" cannot be used as a page name in this wiki.