Difference between revisions of "Ec-14 002880"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14808 CPD-14808] == * smiles: ** C1(C(C(C(C(C1O)O)=O)O)O)O * inchi key: ** InChIKey=VYEGBDH...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-KINASE-RXN SHIKIMATE-KINASE-RXN] == * direction: ** REVERSIBLE * common name: ** P-loop c...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-KINASE-RXN SHIKIMATE-KINASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** P-loop containing nucleoside triphosphate hydrolase |
− | * | + | ** shikimate kinase |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/2.7.1.71 EC-2.7.1.71] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | == | + | ** 1 [[SHIKIMATE]][c] '''+''' 1 [[ATP]][c] '''<=>''' 1 [[ADP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[SHIKIMATE-5P]][c] |
− | * [[ | + | * With common name(s): |
+ | ** 1 shikimate[c] '''+''' 1 ATP[c] '''<=>''' 1 ADP[c] '''+''' 1 H+[c] '''+''' 1 shikimate 3-phosphate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-02_005600]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Gene: [[Ec-11_000770]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | == Pathways == | ||
+ | * [[PWY-6163]], chorismate biosynthesis from 3-dehydroquinate: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6163 PWY-6163] | ||
+ | ** '''6''' reactions found over '''6''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13121 13121] |
− | * | + | * LIGAND-RXN: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02412 R02412] |
− | {{#set: | + | * UNIPROT: |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P0A6D7 P0A6D7] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/Q9PIB5 Q9PIB5] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P07547 P07547] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P08566 P08566] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P43880 P43880] |
+ | ** [http://www.uniprot.org/uniprot/P63600 P63600] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9CEU1 Q9CEU1] | ||
+ | ** [http://www.uniprot.org/uniprot/P37944 P37944] | ||
+ | ** [http://www.uniprot.org/uniprot/P0A6E1 P0A6E1] | ||
+ | ** [http://www.uniprot.org/uniprot/P10880 P10880] | ||
+ | ** [http://www.uniprot.org/uniprot/Q00497 Q00497] | ||
+ | ** [http://www.uniprot.org/uniprot/P34003 P34003] | ||
+ | ** [http://www.uniprot.org/uniprot/P43906 P43906] | ||
+ | ** [http://www.uniprot.org/uniprot/P72796 P72796] | ||
+ | {{#set: direction=REVERSIBLE}} | ||
+ | {{#set: common name=P-loop containing nucleoside triphosphate hydrolase}} | ||
+ | {{#set: common name=shikimate kinase}} | ||
+ | {{#set: ec number=EC-2.7.1.71}} | ||
+ | {{#set: gene associated=Ec-02_005600|Ec-11_000770}} | ||
+ | {{#set: in pathway=PWY-6163}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Revision as of 13:27, 21 March 2018
Contents
Reaction SHIKIMATE-KINASE-RXN
- direction:
- REVERSIBLE
- common name:
- P-loop containing nucleoside triphosphate hydrolase
- shikimate kinase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 SHIKIMATE[c] + 1 ATP[c] <=> 1 ADP[c] + 1 PROTON[c] + 1 SHIKIMATE-5P[c]
- With common name(s):
- 1 shikimate[c] + 1 ATP[c] <=> 1 ADP[c] + 1 H+[c] + 1 shikimate 3-phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-02_005600
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome
- Gene: Ec-11_000770
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
Pathways
- PWY-6163, chorismate biosynthesis from 3-dehydroquinate: PWY-6163
- 6 reactions found over 6 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: