Difference between revisions of "PWY-6269"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PG 2-PG] == * smiles: ** C(=O)([O-])C(OP(=O)([O-])[O-])CO * inchi key: ** InChIKey=GXIURPTVHJ...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5805 PWY-5805] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PG 2-PG] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5805 PWY-5805] ==
* smiles:
+
* taxonomic range:
** C(=O)([O-])C(OP(=O)([O-])[O-])CO
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
** InChIKey=GXIURPTVHJPJLF-UWTATZPHSA-K
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
 
* common name:
 
* common name:
** 2-phospho-D-glycerate
+
** nonaprenyl diphosphate biosynthesis I
* molecular weight:
+
** 183.034   
+
 
* Synonym(s):
 
* Synonym(s):
** 2-phospho-(D)-glycerate
+
** solanesyl diphosphate biosynthesis
** 2-phospho-(R)-glycerate
+
** solanesyl pyrophosphate biosynthesis
** 2-phospho-D-glyceric acid
+
** 2-P-D-glycerate
+
** D-Glycerate 2-phosphate
+
** D-2-phosphoglycerate
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[PHOSPHOGLYCERATE-PHOSPHATASE-RXN]]
+
'''1''' reactions found over '''1''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
* [[3PGAREARR-RXN]]
+
*** [[Ec-17_003520]]
* [[2PGADEHYDRAT-RXN]]
+
** 1 reconstruction source(s) associated:
* [[RXN-15513]]
+
*** [[annotation-esiliculosus_genome]]
* [[RXN-15510]]
+
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* CAS : 2553-59-5
+
{{#set: taxonomic range=TAX-2759}}
* BIGG : 35542
+
{{#set: taxonomic range=TAX-2}}
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2157}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=40467846 40467846]
+
{{#set: common name=nonaprenyl diphosphate biosynthesis I}}
* HMDB : HMDB03391
+
{{#set: common name=solanesyl diphosphate biosynthesis|solanesyl pyrophosphate biosynthesis}}
* LIGAND-CPD:
+
{{#set: reaction found=1}}
** [http://www.genome.jp/dbget-bin/www_bget?C00631 C00631]
+
{{#set: total reaction=1}}
* CHEBI:
+
{{#set: completion rate=100.0}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58289 58289]
+
* METABOLIGHTS : MTBLC58289
+
{{#set: smiles=C(=O)([O-])C(OP(=O)([O-])[O-])CO}}
+
{{#set: inchi key=InChIKey=GXIURPTVHJPJLF-UWTATZPHSA-K}}
+
{{#set: common name=2-phospho-D-glycerate}}
+
{{#set: molecular weight=183.034    }}
+
{{#set: common name=2-phospho-(D)-glycerate|2-phospho-(R)-glycerate|2-phospho-D-glyceric acid|2-P-D-glycerate|D-Glycerate 2-phosphate|D-2-phosphoglycerate}}
+
{{#set: consumed by=PHOSPHOGLYCERATE-PHOSPHATASE-RXN}}
+
{{#set: reversible reaction associated=3PGAREARR-RXN|2PGADEHYDRAT-RXN|RXN-15513|RXN-15510}}
+

Revision as of 13:28, 21 March 2018

Pathway PWY-5805

  • taxonomic range:
  • common name:
    • nonaprenyl diphosphate biosynthesis I
  • Synonym(s):
    • solanesyl diphosphate biosynthesis
    • solanesyl pyrophosphate biosynthesis

Reaction(s) found

1 reactions found over 1 reactions in the full pathway

Reaction(s) not found

External links