Difference between revisions of "RXN-9658"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-GUANIDO-BUTYRAMIDE 4-GUANIDO-BUTYRAMIDE] == * smiles: ** C(NC(N)=[N+])CCC(=O)N * inchi key: *...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-GUANIDO-BUTYRAMIDE 4-GUANIDO-BUTYRAMIDE] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
** C(NC(N)=[N+])CCC(=O)N
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
* inchi key:
 +
** InChIKey=YHVFECVVGNXFKO-UHFFFAOYSA-O
 
* common name:
 
* common name:
−
** palmitate biosynthesis II (bacteria and plants)
+
** 4-guanidinobutyramide
 +
* molecular weight:
 +
** 145.184   
 
* Synonym(s):
 
* Synonym(s):
−
** palmitic acid biosynthesis
+
** 4-guanidinobutanamide
−
** de novo lipogenesis
+
** 4-guanidobutanamide
 +
** 4-guanido-butyramide
 +
** γ-guanidinobutyramide
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''28''' reactions found over '''31''' reactions in the full pathway
+
* [[GUANIDINOBUTANAMIDE-NH3-RXN]]
−
* [[4.2.1.58-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** 0 associated gene:
+
* [[ARGININE-2-MONOOXYGENASE-RXN]]
−
** 1 reconstruction source(s) associated:
+
== Reaction(s) of unknown directionality ==
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[4.2.1.61-RXN]]
+
−
** 0 associated gene:
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
+
−
* [[RXN-16393]]
+
−
** 4 associated gene(s):
+
−
*** [[Ec-03_003710]]
+
−
*** [[Ec-01_001560]]
+
−
*** [[Ec-12_008720]]
+
−
*** [[Ec-02_006430]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN-9514]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-01_007100]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN-9516]]
+
−
** 4 associated gene(s):
+
−
*** [[Ec-27_003480]]
+
−
*** [[Ec-27_002090]]
+
−
*** [[Ec-12_000650]]
+
−
*** [[Ec-12_000640]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[RXN-9518]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-01_007100]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN-9523]]
+
−
** 4 associated gene(s):
+
−
*** [[Ec-27_002090]]
+
−
*** [[Ec-12_000640]]
+
−
*** [[Ec-12_000650]]
+
−
*** [[Ec-27_003480]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[RXN-9524]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-01_007100]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN-9527]]
+
−
** 4 associated gene(s):
+
−
*** [[Ec-12_000640]]
+
−
*** [[Ec-27_003480]]
+
−
*** [[Ec-12_000650]]
+
−
*** [[Ec-27_002090]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[RXN-9528]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-01_007100]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN-9531]]
+
−
** 4 associated gene(s):
+
−
*** [[Ec-27_002090]]
+
−
*** [[Ec-27_003480]]
+
−
*** [[Ec-12_000650]]
+
−
*** [[Ec-12_000640]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[RXN-9532]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-01_007100]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN-9533]]
+
−
** 0 associated gene:
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
+
−
* [[RXN-9535]]
+
−
** 4 associated gene(s):
+
−
*** [[Ec-27_002090]]
+
−
*** [[Ec-12_000650]]
+
−
*** [[Ec-27_003480]]
+
−
*** [[Ec-12_000640]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[RXN-9536]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-01_007100]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN-9537]]
+
−
** 0 associated gene:
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
+
−
* [[RXN-9539]]
+
−
** 4 associated gene(s):
+
−
*** [[Ec-12_000650]]
+
−
*** [[Ec-12_000640]]
+
−
*** [[Ec-27_002090]]
+
−
*** [[Ec-27_003480]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[RXN-9540]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-01_007100]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN-9549]]
+
−
** 0 associated gene:
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
+
−
* [[RXN-9623]]
+
−
** 4 associated gene(s):
+
−
*** [[Ec-01_001560]]
+
−
*** [[Ec-02_006430]]
+
−
*** [[Ec-03_003710]]
+
−
*** [[Ec-12_008720]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[RXN-9655]]
+
−
** 0 associated gene:
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
+
−
* [[RXN-9657]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-27_002470]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN-9658]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-27_002470]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN-9659]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-27_002470]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN-9660]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-27_002470]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN-9661]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-27_002470]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN-9662]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-27_002470]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN-9663]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-27_002470]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=3.1.2.21-RXN 3.1.2.21-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=4.2.1.59-RXN 4.2.1.59-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9520 RXN-9520]
+
 
== External links  ==
 
== External links  ==
−
* ECOCYC:
+
* PUBCHEM:
−
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-5971 PWY-5971]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243936 25243936]
−
{{#set: taxonomic range=TAX-33090}}
+
* CHEBI:
−
{{#set: taxonomic range=TAX-2}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58365 58365]
−
{{#set: common name=palmitate biosynthesis II (bacteria and plants)}}
+
* LIGAND-CPD:
−
{{#set: common name=palmitic acid biosynthesis|de novo lipogenesis}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C03078 C03078]
−
{{#set: reaction found=28}}
+
{{#set: smiles=C(NC(N)=[N+])CCC(=O)N}}
−
{{#set: total reaction=31}}
+
{{#set: inchi key=InChIKey=YHVFECVVGNXFKO-UHFFFAOYSA-O}}
−
{{#set: completion rate=90.0}}
+
{{#set: common name=4-guanidinobutyramide}}
 +
{{#set: molecular weight=145.184    }}
 +
{{#set: common name=4-guanidinobutanamide|4-guanidobutanamide|4-guanido-butyramide|γ-guanidinobutyramide}}
 +
{{#set: consumed by=GUANIDINOBUTANAMIDE-NH3-RXN}}
 +
{{#set: produced by=ARGININE-2-MONOOXYGENASE-RXN}}

Revision as of 13:28, 21 March 2018

Metabolite 4-GUANIDO-BUTYRAMIDE

  • smiles:
    • C(NC(N)=[N+])CCC(=O)N
  • inchi key:
    • InChIKey=YHVFECVVGNXFKO-UHFFFAOYSA-O
  • common name:
    • 4-guanidinobutyramide
  • molecular weight:
    • 145.184
  • Synonym(s):
    • 4-guanidinobutanamide
    • 4-guanidobutanamide
    • 4-guanido-butyramide
    • γ-guanidinobutyramide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(NC(N)=[N+])CCC(=O)N" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-9658&oldid=18926"