Difference between revisions of "RXN-8443"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MANNPISOM-RXN MANNPISOM-RXN] == * direction: ** REVERSIBLE * common name: ** RmlC-like cupin domain...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8608 CPD-8608] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=MANNPISOM-RXN MANNPISOM-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8608 CPD-8608] ==
* direction:
+
* smiles:
** REVERSIBLE
+
** CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
 +
* inchi key:
 +
** InChIKey=MKMLAQLNFVFNRK-PUXRVUTHSA-N
 
* common name:
 
* common name:
** RmlC-like cupin domain
+
** 4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol
** Mannose-6-phosphate isomerase
+
* molecular weight:
** RmlC-like jelly roll fold
+
** 442.724   
* ec number:
+
** [http://enzyme.expasy.org/EC/5.3.1.8 EC-5.3.1.8]
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN66-13]]
** 1 [[CPD-15979]][c] '''<=>''' 1 [[FRUCTOSE-6P]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN66-12]]
** 1 D-mannopyranose 6-phosphate[c] '''<=>''' 1 &beta;-D-fructofuranose 6-phosphate[c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Ec-20_000830]]
+
** ESILICULOSUS_GENOME
+
***EC-NUMBER
+
** [[pantograph]]-[[aragem]]
+
* [[Ec-27_005440]]
+
** ESILICULOSUS_GENOME
+
***EC-NUMBER
+
** [[pantograph]]-[[aragem]]
+
* [[Ec-28_000050]]
+
** ESILICULOSUS_GENOME
+
***EC-NUMBER
+
** [[pantograph]]-[[aragem]]
+
* [[Ec-28_000080]]
+
** ESILICULOSUS_GENOME
+
***EC-NUMBER
+
** [[pantograph]]-[[aragem]]
+
== Pathways  ==
+
* [[MANNCAT-PWY]], D-mannose degradation: [http://metacyc.org/META/NEW-IMAGE?object=MANNCAT-PWY MANNCAT-PWY]
+
** '''1''' reactions found over '''1''' reactions in the full pathway
+
* [[PWY-882]], L-ascorbate biosynthesis I (L-galactose pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY-882 PWY-882]
+
** '''7''' reactions found over '''8''' reactions in the full pathway
+
* [[PWY-7456]], mannan degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7456 PWY-7456]
+
** '''2''' reactions found over '''7''' reactions in the full pathway
+
* [[PWY-3881]], mannitol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3881 PWY-3881]
+
** '''2''' reactions found over '''3''' reactions in the full pathway
+
* [[PWY-5659]], GDP-mannose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5659 PWY-5659]
+
** '''4''' reactions found over '''4''' reactions in the full pathway
+
* [[PWY-6992]], 1,5-anhydrofructose degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6992 PWY-6992]
+
** '''3''' reactions found over '''5''' reactions in the full pathway
+
* [[PWY-3861]], mannitol degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3861 PWY-3861]
+
** '''2''' reactions found over '''4''' reactions in the full pathway
+
* [[PWY-7586]], &beta;-1,4-D-mannosyl-N-acetyl-D-glucosamine degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7586 PWY-7586]
+
** '''2''' reactions found over '''3''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[orthology]]
+
** Source: [[orthology-aragem]]
+
*** Tool: [[pantograph]]
+
* Category: [[annotation]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
* RHEA:
+
* PUBCHEM:
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=12356 12356]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203343 25203343]
* LIGAND-RXN:
+
* HMDB : HMDB12159
** [http://www.genome.jp/dbget-bin/www_bget?R00772 R00772]
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}}
* UNIPROT:
+
{{#set: inchi key=InChIKey=MKMLAQLNFVFNRK-PUXRVUTHSA-N}}
** [http://www.uniprot.org/uniprot/P07874 P07874]
+
{{#set: common name=4,4-dimethyl-14&alpha;-formyl-5&alpha;-cholesta-8-en-3&beta;-ol}}
** [http://www.uniprot.org/uniprot/P29951 P29951]
+
{{#set: molecular weight=442.724    }}
** [http://www.uniprot.org/uniprot/P39841 P39841]
+
{{#set: consumed by=RXN66-13}}
** [http://www.uniprot.org/uniprot/P00946 P00946]
+
{{#set: produced by=RXN66-12}}
** [http://www.uniprot.org/uniprot/P25081 P25081]
+
** [http://www.uniprot.org/uniprot/Q52206 Q52206]
+
** [http://www.uniprot.org/uniprot/P34949 P34949]
+
** [http://www.uniprot.org/uniprot/P29952 P29952]
+
** [http://www.uniprot.org/uniprot/P34948 P34948]
+
** [http://www.uniprot.org/uniprot/Q55183 Q55183]
+
** [http://www.uniprot.org/uniprot/P73377 P73377]
+
{{#set: direction=REVERSIBLE}}
+
{{#set: common name=RmlC-like cupin domain}}
+
{{#set: common name=Mannose-6-phosphate isomerase}}
+
{{#set: common name=RmlC-like jelly roll fold}}
+
{{#set: ec number=EC-5.3.1.8}}
+
{{#set: gene associated=Ec-20_000830|Ec-27_005440|Ec-28_000050|Ec-28_000080}}
+
{{#set: in pathway=MANNCAT-PWY|PWY-882|PWY-7456|PWY-3881|PWY-5659|PWY-6992|PWY-3861|PWY-7586}}
+
{{#set: reconstruction category=orthology|annotation}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
+

Revision as of 13:28, 21 March 2018

Metabolite CPD-8608

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
  • inchi key:
    • InChIKey=MKMLAQLNFVFNRK-PUXRVUTHSA-N
  • common name:
    • 4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol
  • molecular weight:
    • 442.724
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.