Difference between revisions of "RXN-13482"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17332 CPD-17332] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C...")
(Created page with "Category:Gene == Gene Ec-09_002610 == * left end position: ** 2959555 * transcription direction: ** NEGATIVE * right end position: ** 2975638 * centisome position: ** 52.7...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17332 CPD-17332] ==
+
== Gene Ec-09_002610 ==
* smiles:
+
* left end position:
** CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** 2959555
* inchi key:
+
* transcription direction:
** InChIKey=UQPANOGFYCZRAV-AFQBPCMKSA-J
+
** NEGATIVE
* common name:
+
* right end position:
** 3-oxo-tetracosapentaenoyl-CoA
+
** 2975638
* molecular weight:
+
* centisome position:
** 1118.034    
+
** 52.725285    
 
* Synonym(s):
 
* Synonym(s):
** 3-oxo-(9Z,12Z,15Z,18Z,21Z)-tetracosapentaenoyl-CoA
+
** Esi_0171_0021
** 3-oxo-all-cis-9,12,15,18,21-tetracosapentaenoyl-CoA
+
** Esi0171_0021
** 3-oxo-(9Z,12Z,15Z,18Z,21Z)-tetracosa-9,12,15,18,21-pentaenoyl-CoA
+
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-16129]]
+
* Reaction: [[3.6.4.4-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
* [[RXN-16082]]
+
*** Assignment: automated-name-match
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=2959555}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581129 71581129]
+
{{#set: transcription direction=NEGATIVE}}
* CHEBI:
+
{{#set: right end position=2975638}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73871 73871]
+
{{#set: centisome position=52.725285   }}
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: common name=Esi_0171_0021|Esi0171_0021}}
{{#set: inchi key=InChIKey=UQPANOGFYCZRAV-AFQBPCMKSA-J}}
+
{{#set: reaction associated=3.6.4.4-RXN}}
{{#set: common name=3-oxo-tetracosapentaenoyl-CoA}}
+
{{#set: molecular weight=1118.034   }}
+
{{#set: common name=3-oxo-(9Z,12Z,15Z,18Z,21Z)-tetracosapentaenoyl-CoA|3-oxo-all-cis-9,12,15,18,21-tetracosapentaenoyl-CoA|3-oxo-(9Z,12Z,15Z,18Z,21Z)-tetracosa-9,12,15,18,21-pentaenoyl-CoA}}
+
{{#set: consumed by=RXN-16129}}
+
{{#set: produced by=RXN-16082}}
+

Revision as of 13:29, 21 March 2018

Gene Ec-09_002610

  • left end position:
    • 2959555
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 2975638
  • centisome position:
    • 52.725285
  • Synonym(s):
    • Esi_0171_0021
    • Esi0171_0021

Reactions associated

Pathways associated

External links