Difference between revisions of "GLYCOGENSYNTH-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-114 CPD1F-114] == * smiles: ** CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC=C(CCC=C(C)C)C)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DATP DATP] == * smiles: ** C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP(OP(OP(=O)([O-])[O-])([...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DATP DATP] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=SUYVUBYJARFZHO-RRKCRQDMSA-J |
* common name: | * common name: | ||
| − | ** | + | ** dATP |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 487.152 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 2'-deoxyATP |
| + | ** 2'-deoxyadenosine triphosphate | ||
| + | ** deoxy-ATP | ||
| + | ** deoxyadenosine-triphosphate | ||
| + | ** 2'-deoxyadenosine-5'-triphosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-14195]] |
| + | * [[RXN-14214]] | ||
| + | * [[RXN-14290]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[DADPKIN-RXN]] | ||
| + | * [[RXN0-745]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[RXN-14192]] |
== External links == | == External links == | ||
| − | * | + | * CAS : 1927-31-7 |
| + | * BIGG : 33969 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25320183 25320183] |
| − | * HMDB : | + | * HMDB : HMDB01532 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00131 C00131] |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61404 61404] |
| − | * METABOLIGHTS : | + | * METABOLIGHTS : MTBLC61404 |
| − | {{#set: smiles= | + | {{#set: smiles=C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=SUYVUBYJARFZHO-RRKCRQDMSA-J}} |
| − | {{#set: common name= | + | {{#set: common name=dATP}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=487.152 }} |
| − | {{#set: common name= | + | {{#set: common name=2'-deoxyATP|2'-deoxyadenosine triphosphate|deoxy-ATP|deoxyadenosine-triphosphate|2'-deoxyadenosine-5'-triphosphate}} |
| − | {{#set: consumed by= | + | {{#set: consumed by=RXN-14195|RXN-14214|RXN-14290}} |
| − | {{#set: reversible reaction associated= | + | {{#set: produced by=DADPKIN-RXN|RXN0-745}} |
| + | {{#set: reversible reaction associated=RXN-14192}} | ||
Revision as of 14:29, 21 March 2018
Contents
Metabolite DATP
- smiles:
- C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O
- inchi key:
- InChIKey=SUYVUBYJARFZHO-RRKCRQDMSA-J
- common name:
- dATP
- molecular weight:
- 487.152
- Synonym(s):
- 2'-deoxyATP
- 2'-deoxyadenosine triphosphate
- deoxy-ATP
- deoxyadenosine-triphosphate
- 2'-deoxyadenosine-5'-triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 1927-31-7
- BIGG : 33969
- PUBCHEM:
- HMDB : HMDB01532
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC61404
"C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O" cannot be used as a page name in this wiki.
