Difference between revisions of "Ec-01 000360"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta17-3-hydroxyC36-ACPs cis-delta17-3-hydroxyC36-ACPs] == * common name: ** a cis-delta17...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7214 CPD-7214] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3O)O)O) * i...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7214 CPD-7214] == |
+ | * smiles: | ||
+ | ** C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3O)O)O) | ||
+ | * inchi key: | ||
+ | ** InChIKey=USQXPEWRYWRRJD-LBPRGKRZSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** (2S)-dihydrotricetin |
+ | * molecular weight: | ||
+ | ** 303.248 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 3',4',5'-pentahydroxyflavanone | ||
+ | ** 5,7,3',4',5'-pentahydroxyflavanone | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-7922]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658763 90658763] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=48026 48026] | ||
+ | * METABOLIGHTS : MTBLC48026 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05911 C05911] | ||
+ | {{#set: smiles=C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3O)O)O)}} | ||
+ | {{#set: inchi key=InChIKey=USQXPEWRYWRRJD-LBPRGKRZSA-M}} | ||
+ | {{#set: common name=(2S)-dihydrotricetin}} | ||
+ | {{#set: molecular weight=303.248 }} | ||
+ | {{#set: common name=3',4',5'-pentahydroxyflavanone|5,7,3',4',5'-pentahydroxyflavanone}} | ||
+ | {{#set: consumed by=RXN-7922}} |
Revision as of 14:29, 21 March 2018
Contents
Metabolite CPD-7214
- smiles:
- C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3O)O)O)
- inchi key:
- InChIKey=USQXPEWRYWRRJD-LBPRGKRZSA-M
- common name:
- (2S)-dihydrotricetin
- molecular weight:
- 303.248
- Synonym(s):
- 3',4',5'-pentahydroxyflavanone
- 5,7,3',4',5'-pentahydroxyflavanone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3O)O)O)" cannot be used as a page name in this wiki.