Difference between revisions of "CPD-19161"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13187 CPD-13187] == * smiles: ** CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Methylated-Ribosomal-Protein-L11s Methylated-Ribosomal-Protein-L11s] == * common name: ** a met...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13187 CPD-13187] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Methylated-Ribosomal-Protein-L11s Methylated-Ribosomal-Protein-L11s] ==
* smiles:
+
** CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)C(O)3)OC4(OC(C([O-])=O)=CC(O)C(O)4)))
+
* inchi key:
+
** InChIKey=JMDPLHPAGLYHCI-DPADXCMISA-M
+
 
* common name:
 
* common name:
** unsaturated gellan tetrasaccharide
+
** a methylated ribosomal protein L11
* molecular weight:
+
** 645.544   
+
 
* Synonym(s):
 
* Synonym(s):
** β-D-4-deoxy-Δ4,5-GlcAp-(1→4)-β-D-Glcp-(1→4)-α-L-Rhap-(1→3)-β-D-Glcp
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12270]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN0-5419]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a methylated ribosomal protein L11}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940141 52940141]
+
{{#set: produced by=RXN0-5419}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63254 63254]
+
{{#set: smiles=CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)C(O)3)OC4(OC(C([O-])=O)=CC(O)C(O)4)))}}
+
{{#set: inchi key=InChIKey=JMDPLHPAGLYHCI-DPADXCMISA-M}}
+
{{#set: common name=unsaturated gellan tetrasaccharide}}
+
{{#set: molecular weight=645.544    }}
+
{{#set: common name=β-D-4-deoxy-Δ4,5-GlcAp-(1→4)-β-D-Glcp-(1→4)-α-L-Rhap-(1→3)-β-D-Glcp}}
+
{{#set: consumed by=RXN-12270}}
+

Revision as of 13:30, 21 March 2018

Metabolite Methylated-Ribosomal-Protein-L11s

  • common name:
    • a methylated ribosomal protein L11
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links