Difference between revisions of "Ec-07 002990"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOCHORISMATE ISOCHORISMATE] == * smiles: ** C=C(C(=O)[O-])OC1(C=CC=C(C1O)C([O-])=O) * inchi ke...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Adenosines-37 tRNA-Adenosines-37] == * common name: ** an adenosine37 in tRNA * Synonym(s)...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOCHORISMATE ISOCHORISMATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Adenosines-37 tRNA-Adenosines-37] ==
* smiles:
+
** C=C(C(=O)[O-])OC1(C=CC=C(C1O)C([O-])=O)
+
* inchi key:
+
** InChIKey=NTGWPRCCOQCMGE-YUMQZZPRSA-L
+
 
* common name:
 
* common name:
** isochorismate
+
** an adenosine37 in tRNA
* molecular weight:
+
** 224.17   
+
 
* Synonym(s):
 
* Synonym(s):
** Isochorismic acid
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN0-6274]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[ISOCHORSYN-RXN]]
 
 
== External links  ==
 
== External links  ==
* CAS : 22642-82-6
+
{{#set: common name=an adenosine37 in tRNA}}
* DRUGBANK : DB02793
+
{{#set: consumed by=RXN0-6274}}
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460580 5460580]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00885 C00885]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.4574080.html 4574080]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29780 29780]
+
* BIGG : 36293
+
{{#set: smiles=C=C(C(=O)[O-])OC1(C=CC=C(C1O)C([O-])=O)}}
+
{{#set: inchi key=InChIKey=NTGWPRCCOQCMGE-YUMQZZPRSA-L}}
+
{{#set: common name=isochorismate}}
+
{{#set: molecular weight=224.17    }}
+
{{#set: common name=Isochorismic acid}}
+
{{#set: reversible reaction associated=ISOCHORSYN-RXN}}
+

Revision as of 13:30, 21 March 2018

Metabolite tRNA-Adenosines-37

  • common name:
    • an adenosine37 in tRNA
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links