|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ASPARTATEKIN-RXN ASPARTATEKIN-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2189 CPD0-2189] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** C(O)C(O)C([N+])C(=O)[O-] |
| + | * inchi key: |
| + | ** InChIKey=JBNUARFQOCGDRK-GBXIJSLDSA-N |
| * common name: | | * common name: |
− | ** aspartate/glutamate/uridylate kinase | + | ** 4-hydroxy-L-threonine |
− | ** aspartate kinase/homoserine dehydrogenase | + | * molecular weight: |
− | ** Aspartate/glutamate/uridylate kinase
| + | ** 135.119 |
− | ** aspartate kinase
| + | |
− | * ec number:
| + | |
− | ** [http://enzyme.expasy.org/EC/2.7.2.4 EC-2.7.2.4] | + | |
| * Synonym(s): | | * Synonym(s): |
| + | ** (2S,3S)-2-amino-3,4-dihydroxybutanoic acid |
| + | ** hydroxythreonine |
| + | ** 3-hydroxyhomoserine |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | == Reaction(s) known to produce the compound == |
− | ** 1 [[L-ASPARTATE]][c] '''+''' 1 [[ATP]][c] '''<=>''' 1 [[L-BETA-ASPARTYL-P]][c] '''+''' 1 [[ADP]][c]
| + | * [[RXN-14125]] |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 L-aspartate[c] '''+''' 1 ATP[c] '''<=>''' 1 L-aspartyl-4-phosphate[c] '''+''' 1 ADP[c]
| + | |
− | | + | |
− | == Genes associated with this reaction ==
| + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Ec-11_000830]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | * [[Ec-13_002530]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-27_003730]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | * [[Ec-24_000610]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | == Pathways ==
| + | |
− | * [[HOMOSERSYN-PWY]], L-homoserine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=HOMOSERSYN-PWY HOMOSERSYN-PWY]
| + | |
− | ** '''3''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[PWY-7153]], grixazone biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7153 PWY-7153]
| + | |
− | ** '''2''' reactions found over '''8''' reactions in the full pathway
| + | |
− | * [[DAPLYSINESYN-PWY]], L-lysine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=DAPLYSINESYN-PWY DAPLYSINESYN-PWY]
| + | |
− | ** '''6''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[PWY-2942]], L-lysine biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2942 PWY-2942]
| + | |
− | ** '''6''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[PWY-2941]], L-lysine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2941 PWY-2941]
| + | |
− | ** '''6''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[PWY-6559]], spermidine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6559 PWY-6559]
| + | |
− | ** '''2''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-6562]], norspermidine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6562 PWY-6562]
| + | |
− | ** '''2''' reactions found over '''6''' reactions in the full pathway
| + | |
− | * [[PWY-5097]], L-lysine biosynthesis VI: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5097 PWY-5097] | + | |
− | ** '''7''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[P101-PWY]], ectoine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=P101-PWY P101-PWY]
| + | |
− | ** '''2''' reactions found over '''5''' reactions in the full pathway
| + | |
− | == Reconstruction information == | + | |
− | * Category: [[orthology]]
| + | |
− | ** Source: [[orthology-aragem]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | * Category: [[annotation]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * CAS : 21768-45-6 |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=23776 23776] | + | * PUBCHEM: |
− | * LIGAND-RXN: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852420 49852420] |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00480 R00480] | + | * LIGAND-CPD: |
− | * UNIPROT: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06056 C06056] |
− | ** [http://www.uniprot.org/uniprot/P08495 P08495] | + | * CHEMSPIDER: |
− | ** [http://www.uniprot.org/uniprot/P44505 P44505]
| + | ** [http://www.chemspider.com/Chemical-Structure.167988.html 167988] |
− | ** [http://www.uniprot.org/uniprot/P27725 P27725] | + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/Q04795 Q04795] | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60904 60904] |
− | ** [http://www.uniprot.org/uniprot/Q57991 Q57991]
| + | * BIGG : 1450010 |
− | ** [http://www.uniprot.org/uniprot/P00561 P00561]
| + | {{#set: smiles=C(O)C(O)C([N+])C(=O)[O-]}} |
− | ** [http://www.uniprot.org/uniprot/P00562 P00562] | + | {{#set: inchi key=InChIKey=JBNUARFQOCGDRK-GBXIJSLDSA-N}} |
− | ** [http://www.uniprot.org/uniprot/Q9PHT4 Q9PHT4]
| + | {{#set: common name=4-hydroxy-L-threonine}} |
− | ** [http://www.uniprot.org/uniprot/Q9JTN3 Q9JTN3]
| + | {{#set: molecular weight=135.119 }} |
− | ** [http://www.uniprot.org/uniprot/P53553 P53553]
| + | {{#set: common name=(2S,3S)-2-amino-3,4-dihydroxybutanoic acid|hydroxythreonine|3-hydroxyhomoserine}} |
− | ** [http://www.uniprot.org/uniprot/P10869 P10869]
| + | {{#set: produced by=RXN-14125}} |
− | ** [http://www.uniprot.org/uniprot/P08660 P08660]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26512 P26512]
| + | |
− | ** [http://www.uniprot.org/uniprot/P37142 P37142]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41403 P41403]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A4Z9 P0A4Z9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9SA18 Q9SA18]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49079 P49079]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49080 P49080]
| + | |
− | ** [http://www.uniprot.org/uniprot/P93402 P93402]
| + | |
− | ** [http://www.uniprot.org/uniprot/O81852 O81852]
| + | |
− | ** [http://www.uniprot.org/uniprot/O63067 O63067]
| + | |
− | ** [http://www.uniprot.org/uniprot/O65027 O65027]
| + | |
− | {{#set: direction=REVERSIBLE}} | + | |
− | {{#set: common name=aspartate/glutamate/uridylate kinase}} | + | |
− | {{#set: common name=aspartate kinase/homoserine dehydrogenase}} | + | |
− | {{#set: common name=Aspartate/glutamate/uridylate kinase}} | + | |
− | {{#set: common name=aspartate kinase}} | + | |
− | {{#set: ec number=EC-2.7.2.4}}
| + | |
− | {{#set: gene associated=Ec-11_000830|Ec-13_002530|Ec-27_003730|Ec-24_000610}}
| + | |
− | {{#set: in pathway=HOMOSERSYN-PWY|PWY-7153|DAPLYSINESYN-PWY|PWY-2942|PWY-2941|PWY-6559|PWY-6562|PWY-5097|P101-PWY}}
| + | |
− | {{#set: reconstruction category=orthology|annotation}} | + | |
− | {{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
| + | |
− | {{#set: reconstruction tool=pantograph|pathwaytools}}
| + | |