Difference between revisions of "Ec-09 000640"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2942 PWY-2942] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19161 CPD-19161] == * smiles: ** CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2942 PWY-2942] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19161 CPD-19161] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* inchi key:
 +
** InChIKey=MWKSUVQQMPJTPP-DTPVMWFYSA-J
 
* common name:
 
* common name:
** L-lysine biosynthesis III
+
** (2E,7Z)-tetradecenoyl-CoA
 +
* molecular weight:
 +
** 969.83   
 
* Synonym(s):
 
* Synonym(s):
 +
** 14:2-Δ2,Δ7-CoA
 +
** 2-trans,7-cis-tetradecenoyl-CoA
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''6''' reactions found over '''7''' reactions in the full pathway
+
* [[RXN-17793]]
* [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** 1 associated gene(s):
+
* [[RXN-17792]]
*** [[Ec-01_007470]]
+
== Reaction(s) of unknown directionality ==
** 2 reconstruction source(s) associated:
+
*** [[annotation-esiliculosus_genome]]
+
*** [[orthology-aragem]]
+
* [[ASPARTATEKIN-RXN]]
+
** 4 associated gene(s):
+
*** [[Ec-11_000830]]
+
*** [[Ec-13_002530]]
+
*** [[Ec-27_003730]]
+
*** [[Ec-24_000610]]
+
** 2 reconstruction source(s) associated:
+
*** [[annotation-esiliculosus_genome]]
+
*** [[orthology-aragem]]
+
* [[DIAMINOPIMDECARB-RXN]]
+
** 4 associated gene(s):
+
*** [[Ec-01_000060]]
+
*** [[Ec-09_002410]]
+
*** [[Ec-09_002360]]
+
*** [[Ec-09_002420]]
+
** 2 reconstruction source(s) associated:
+
*** [[annotation-esiliculosus_genome]]
+
*** [[orthology-aragem]]
+
* [[DIHYDRODIPICSYN-RXN]]
+
** 0 associated gene:
+
** 1 reconstruction source(s) associated:
+
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
+
* [[RXN-14014]]
+
** 1 associated gene(s):
+
*** [[Ec-15_000750]]
+
** 1 reconstruction source(s) associated:
+
*** [[annotation-esiliculosus_genome]]
+
* [[RXN-4821]]
+
** 0 associated gene:
+
** 1 reconstruction source(s) associated:
+
*** [[annotation-esiliculosus_genome]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=DIAMINOPIMELATE-DEHYDROGENASE-RXN DIAMINOPIMELATE-DEHYDROGENASE-RXN]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-2}}
+
{{#set: smiles=CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: common name=L-lysine biosynthesis III}}
+
{{#set: inchi key=InChIKey=MWKSUVQQMPJTPP-DTPVMWFYSA-J}}
{{#set: reaction found=6}}
+
{{#set: common name=(2E,7Z)-tetradecenoyl-CoA}}
{{#set: total reaction=7}}
+
{{#set: molecular weight=969.83    }}
{{#set: completion rate=86.0}}
+
{{#set: common name=14:2-Δ2,Δ7-CoA|2-trans,7-cis-tetradecenoyl-CoA}}
 +
{{#set: consumed by=RXN-17793}}
 +
{{#set: produced by=RXN-17792}}

Revision as of 13:30, 21 March 2018

Metabolite CPD-19161

  • smiles:
    • CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=MWKSUVQQMPJTPP-DTPVMWFYSA-J
  • common name:
    • (2E,7Z)-tetradecenoyl-CoA
  • molecular weight:
    • 969.83
  • Synonym(s):
    • 14:2-Δ2,Δ7-CoA
    • 2-trans,7-cis-tetradecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.