Difference between revisions of "RXN-11373"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GERANYLGERANYL-PP GERANYLGERANYL-PP] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-303 RXN66-303] == * direction: ** LEFT-TO-RIGHT * common name: ** lanosterol 14-hydroxylase *...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GERANYLGERANYL-PP GERANYLGERANYL-PP] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-303 RXN66-303] ==
−
* smiles:
+
* direction:
−
** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=OINNEUNVOZHBOX-QIRCYJPOSA-K
+
 
* common name:
 
* common name:
−
** geranylgeranyl diphosphate
+
** lanosterol 14-hydroxylase
−
* molecular weight:
+
** Cytochrome P450
−
** 447.424   
+
 
* Synonym(s):
 
* Synonym(s):
−
** all-trans-geranyl-geranyl-pp
 
−
** geranylgeranyl-PP
 
−
** GGPP
 
−
** geranylgeranyl diphosphate
 
−
** (2E,6E,10E)-geranylgeranyl diphosphate
 
−
** ω,E,E,E-geranylgeranyl diphosphate
 
−
** (2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-yl diphosphate
 
−
** all-trans-geranylgeranyl diphosphate
 
−
** 2-trans,6-trans,10-trans-geranylgeranyl diphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-7658]]
+
* With identifiers:
−
* [[2.5.1.32-RXN]]
+
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[LANOSTEROL]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[CPD-4568]][c] '''+''' 1 [[WATER]][c]
−
* [[RXN-10625]]
+
* With common name(s):
−
* [[2.5.1.41-RXN]]
+
** 1 oxygen[c] '''+''' 1 H+[c] '''+''' 1 NADPH[c] '''+''' 1 lanosterol[c] '''=>''' 1 NADP+[c] '''+''' 1 14-hydroxylanosterol[c] '''+''' 1 H2O[c]
−
* [[RXN-11486]]
+
 
−
== Reaction(s) known to produce the compound ==
+
== Genes associated with this reaction  ==
−
* [[FARNESYLTRANSTRANSFERASE-RXN]]
+
Genes have been associated with this reaction based on different elements listed below.
−
== Reaction(s) of unknown directionality ==
+
* Gene: [[Ec-10_006240]]
−
* [[RXN1F-144]]
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-3701]]
+
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY66-341]], cholesterol biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-341 PWY66-341]
 +
** '''9''' reactions found over '''22''' reactions in the full pathway
 +
* [[PWY66-4]], cholesterol biosynthesis III (via desmosterol): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-4 PWY66-4]
 +
** '''9''' reactions found over '''22''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB07841
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=lanosterol 14-hydroxylase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5497105 5497105]
+
{{#set: common name=Cytochrome P450}}
−
* HMDB : HMDB04486
+
{{#set: gene associated=Ec-10_006240}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY66-341|PWY66-4}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00353 C00353]
+
{{#set: reconstruction category=annotation}}
−
* CHEMSPIDER:
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
** [http://www.chemspider.com/Chemical-Structure.4593687.html 4593687]
+
{{#set: reconstruction tool=pathwaytools}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58756 58756]
+
−
* METABOLIGHTS : MTBLC58756
+
−
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=OINNEUNVOZHBOX-QIRCYJPOSA-K}}
+
−
{{#set: common name=geranylgeranyl diphosphate}}
+
−
{{#set: molecular weight=447.424    }}
+
−
{{#set: common name=all-trans-geranyl-geranyl-pp|geranylgeranyl-PP|GGPP|geranylgeranyl diphosphate|(2E,6E,10E)-geranylgeranyl diphosphate|ω,E,E,E-geranylgeranyl diphosphate|(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-yl diphosphate|all-trans-geranylgeranyl diphosphate|2-trans,6-trans,10-trans-geranylgeranyl diphosphate}}
+
−
{{#set: consumed by=RXN-7658|2.5.1.32-RXN|RXN-10625|2.5.1.41-RXN|RXN-11486}}
+
−
{{#set: produced by=FARNESYLTRANSTRANSFERASE-RXN}}
+
−
{{#set: reversible reaction associated=RXN1F-144|RXN-3701}}
+

Revision as of 13:31, 21 March 2018

Reaction RXN66-303

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • lanosterol 14-hydroxylase
    • Cytochrome P450
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY66-341, cholesterol biosynthesis I: PWY66-341
    • 9 reactions found over 22 reactions in the full pathway
  • PWY66-4, cholesterol biosynthesis III (via desmosterol): PWY66-4
    • 9 reactions found over 22 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-11373&oldid=19280"