Difference between revisions of "RXN-4021"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUTP DUTP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)N...")
(Created page with "Category:Gene == Gene Ec-05_004560 == * left end position: ** 6493273 * transcription direction: ** NEGATIVE * right end position: ** 6501002 * centisome position: ** 71.3...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUTP DUTP] ==
+
== Gene Ec-05_004560 ==
−
* smiles:
+
* left end position:
−
** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2))
+
** 6493273
−
* inchi key:
+
* transcription direction:
−
** InChIKey=AHCYMLUZIRLXAA-SHYZEUOFSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** dUTP
+
** 6501002
−
* molecular weight:
+
* centisome position:
−
** 464.112    
+
** 71.32719    
 
* Synonym(s):
 
* Synonym(s):
−
** deoxy-UTP
+
** Esi_0129_0004
−
** 2'-deoxyuridine-5'-triphosphate
+
** Esi0129_0004
−
** deoxyuridine-triphosphate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[DUTP-PYROP-RXN]]
+
* Reaction: [[RXN0-5462]]
−
* [[RXN-14199]]
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-14219]]
+
*** Assignment: automated-name-match
−
== Reaction(s) known to produce the compound ==
+
== Pathways associated ==
−
* [[DUDPKIN-RXN]]
+
−
* [[RXN0-724]]
+
−
== Reaction(s) of unknown directionality ==
+
 
== External links  ==
 
== External links  ==
−
* CAS : 1173-82-6
+
{{#set: left end position=6493273}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244408 25244408]
+
{{#set: right end position=6501002}}
−
* HMDB : HMDB01191
+
{{#set: centisome position=71.32719   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0129_0004|Esi0129_0004}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00460 C00460]
+
{{#set: reaction associated=RXN0-5462}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61555 61555]
+
−
* BIGG : 35037
+
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2))}}
+
−
{{#set: inchi key=InChIKey=AHCYMLUZIRLXAA-SHYZEUOFSA-J}}
+
−
{{#set: common name=dUTP}}
+
−
{{#set: molecular weight=464.112   }}
+
−
{{#set: common name=deoxy-UTP|2'-deoxyuridine-5'-triphosphate|deoxyuridine-triphosphate}}
+
−
{{#set: consumed by=DUTP-PYROP-RXN|RXN-14199|RXN-14219}}
+
−
{{#set: produced by=DUDPKIN-RXN|RXN0-724}}
+

Revision as of 13:31, 21 March 2018

Gene Ec-05_004560

  • left end position:
    • 6493273
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 6501002
  • centisome position:
    • 71.32719
  • Synonym(s):
    • Esi_0129_0004
    • Esi0129_0004

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-4021&oldid=19312"