Difference between revisions of "PWY-7282"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MYO-INOSITOL MYO-INOSITOL] == * smiles: ** C1(C(C(C(C(C1O)O)O)O)O)O * inchi key: ** InChIKey=CD...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta13-3-hydroxylacceroyl-ACPs cis-delta13-3-hydroxylacceroyl-ACPs] == * common name: ** a...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MYO-INOSITOL MYO-INOSITOL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta13-3-hydroxylacceroyl-ACPs cis-delta13-3-hydroxylacceroyl-ACPs] ==
* smiles:
+
** C1(C(C(C(C(C1O)O)O)O)O)O
+
* inchi key:
+
** InChIKey=CDAISMWEOUEBRE-GPIVLXJGSA-N
+
 
* common name:
 
* common name:
** myo-inositol
+
** a cis-delta13-3-hydroxyC32:1-[acp]
* molecular weight:
+
** 180.157   
+
 
* Synonym(s):
 
* Synonym(s):
** cis-1,2,3,5-trans-4,6-Cyclohexanehexol
 
** dambose
 
** mesoinositol
 
** meso-inositol
 
** M-inositol
 
** 1,2,3,5/4,6 inositol
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[MYO-INOSITOL-OXYGENASE-RXN]]
 
* [[2.7.8.11-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10954]]
+
* [[RXN1G-260]]
* [[RXN-10953]]
+
* [[RXN-7253]]
+
* [[RXN-10952]]
+
* [[RXN-8281]]
+
* [[RXN-10949]]
+
* [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]]
+
* [[RXN0-5408]]
+
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
 
* [[2.4.1.67-RXN]]
 
 
== External links  ==
 
== External links  ==
* CAS : 6917-35-7
+
{{#set: common name=a cis-delta13-3-hydroxyC32:1-[acp]}}
* CAS : 87-89-8
+
{{#set: produced by=RXN1G-260}}
* BIGG : 33990
+
* DRUGBANK : DB03106
+
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=892 892]
+
* KNAPSACK : C00001164
+
* HMDB : HMDB00211
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00137 C00137]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.868.html 868]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17268 17268]
+
* METABOLIGHTS : MTBLC17268
+
{{#set: smiles=C1(C(C(C(C(C1O)O)O)O)O)O}}
+
{{#set: inchi key=InChIKey=CDAISMWEOUEBRE-GPIVLXJGSA-N}}
+
{{#set: common name=myo-inositol}}
+
{{#set: molecular weight=180.157    }}
+
{{#set: common name=cis-1,2,3,5-trans-4,6-Cyclohexanehexol|dambose|mesoinositol|meso-inositol|M-inositol|1,2,3,5/4,6 inositol}}
+
{{#set: consumed by=MYO-INOSITOL-OXYGENASE-RXN|2.7.8.11-RXN}}
+
{{#set: produced by=RXN-10954|RXN-10953|RXN-7253|RXN-10952|RXN-8281|RXN-10949|MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN|RXN0-5408}}
+
{{#set: reversible reaction associated=MYO-INOSITOL-2-DEHYDROGENASE-RXN|2.4.1.67-RXN}}
+

Revision as of 13:31, 21 March 2018

Metabolite cis-delta13-3-hydroxylacceroyl-ACPs

  • common name:
    • a cis-delta13-3-hydroxyC32:1-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a cis-delta13-3-hydroxyC32:1-[acp" cannot be used as a page name in this wiki.