Difference between revisions of "2Fe-2S-proteins"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE L-ASPARTATE] == * smiles: ** C(C(=O)[O-])C([N+])C(=O)[O-] * inchi key: ** InChIKey=...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=THREONINE-ALDOLASE-RXN THREONINE-ALDOLASE-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** t...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=THREONINE-ALDOLASE-RXN THREONINE-ALDOLASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** threonine aldolase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/4.1.2.48 EC-4.1.2.48] |
+ | ** [http://enzyme.expasy.org/EC/4.1.2.5 EC-4.1.2.5] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[THR]][c] '''=>''' 1 [[GLY]][c] '''+''' 1 [[ACETALD]][c] | |
− | + | * With common name(s): | |
− | * [[ | + | ** 1 L-threonine[c] '''=>''' 1 glycine[c] '''+''' 1 acetaldehyde[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * | + | Genes have been associated with this reaction based on different elements listed below. |
− | * [[ | + | * Gene: [[Ec-11_002460]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * | + | *** Assignment: GO-TERM |
− | == | + | * Gene: [[Ec-06_001610]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | + | *** Assignment: GO-TERM | |
− | * [[ | + | == Pathways == |
− | + | * [[GLYSYN-THR-PWY]], glycine biosynthesis IV: [http://metacyc.org/META/NEW-IMAGE?object=GLYSYN-THR-PWY GLYSYN-THR-PWY] | |
− | * [[ | + | ** '''1''' reactions found over '''1''' reactions in the full pathway |
− | * [[ | + | * [[PWY-5436]], L-threonine degradation IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5436 PWY-5436] |
− | * [[ | + | ** '''1''' reactions found over '''2''' reactions in the full pathway |
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19625 19625] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00751 R00751] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | * LIGAND- | + | {{#set: common name=threonine aldolase}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: ec number=EC-4.1.2.48}} |
− | + | {{#set: ec number=EC-4.1.2.5}} | |
− | + | {{#set: gene associated=Ec-11_002460|Ec-06_001610}} | |
− | + | {{#set: in pathway=GLYSYN-THR-PWY|PWY-5436}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 13:31, 21 March 2018
Contents
Reaction THREONINE-ALDOLASE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- threonine aldolase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 L-threonine[c] => 1 glycine[c] + 1 acetaldehyde[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-11_002460
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-06_001610
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
Pathways
- GLYSYN-THR-PWY, glycine biosynthesis IV: GLYSYN-THR-PWY
- 1 reactions found over 1 reactions in the full pathway
- PWY-5436, L-threonine degradation IV: PWY-5436
- 1 reactions found over 2 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links