Difference between revisions of "PWYQT-4429"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11674 CPD-11674] == * smiles: ** C(O)CC1(=CNC2(=C1C=C(OS(=O)(=O)[O-])C=C2)) * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALPHAGALACTOSID-RXN ALPHAGALACTOSID-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Alpha-g...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALPHAGALACTOSID-RXN ALPHAGALACTOSID-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Alpha-galactosidase, family GH36 |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.2.1.22 EC-3.2.1.22] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[MELIBIOSE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Glucopyranose]][c] '''+''' 1 [[D-galactopyranose]][c] |
− | == | + | * With common name(s): |
+ | ** 1 melibiose[c] '''+''' 1 H2O[c] '''=>''' 1 D-glucopyranose[c] '''+''' 1 D-galactopyranose[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-26_006290]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-04_003730]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Gene: [[Ec-17_000840]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY0-1301]], melibiose degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1301 PWY0-1301] | ||
+ | ** '''1''' reactions found over '''1''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=28663 28663] |
− | {{#set: | + | * LIGAND-RXN: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01101 R01101] |
− | {{#set: | + | * UNIPROT: |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P16551 P16551] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P27756 P27756] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P04824 P04824] |
+ | ** [http://www.uniprot.org/uniprot/P06720 P06720] | ||
+ | ** [http://www.uniprot.org/uniprot/P06280 P06280] | ||
+ | ** [http://www.uniprot.org/uniprot/P51569 P51569] | ||
+ | ** [http://www.uniprot.org/uniprot/O93816 O93816] | ||
+ | ** [http://www.uniprot.org/uniprot/Q03647 Q03647] | ||
+ | ** [http://www.uniprot.org/uniprot/P14749 P14749] | ||
+ | ** [http://www.uniprot.org/uniprot/P28351 P28351] | ||
+ | ** [http://www.uniprot.org/uniprot/P43467 P43467] | ||
+ | ** [http://www.uniprot.org/uniprot/Q99172 Q99172] | ||
+ | ** [http://www.uniprot.org/uniprot/P41945 P41945] | ||
+ | ** [http://www.uniprot.org/uniprot/P41946 P41946] | ||
+ | ** [http://www.uniprot.org/uniprot/P41947 P41947] | ||
+ | ** [http://www.uniprot.org/uniprot/Q92457 Q92457] | ||
+ | ** [http://www.uniprot.org/uniprot/Q92456 Q92456] | ||
+ | ** [http://www.uniprot.org/uniprot/Q92451 Q92451] | ||
+ | ** [http://www.uniprot.org/uniprot/O04943 O04943] | ||
+ | ** [http://www.uniprot.org/uniprot/O04944 O04944] | ||
+ | ** [http://www.uniprot.org/uniprot/Q39811 Q39811] | ||
+ | ** [http://www.uniprot.org/uniprot/Q41100 Q41100] | ||
+ | ** [http://www.uniprot.org/uniprot/Q42656 Q42656] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=Alpha-galactosidase, family GH36}} | ||
+ | {{#set: ec number=EC-3.2.1.22}} | ||
+ | {{#set: gene associated=Ec-26_006290|Ec-04_003730|Ec-17_000840}} | ||
+ | {{#set: in pathway=PWY0-1301}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Revision as of 13:32, 21 March 2018
Contents
Reaction ALPHAGALACTOSID-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- Alpha-galactosidase, family GH36
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 MELIBIOSE[c] + 1 WATER[c] => 1 Glucopyranose[c] + 1 D-galactopyranose[c]
- With common name(s):
- 1 melibiose[c] + 1 H2O[c] => 1 D-glucopyranose[c] + 1 D-galactopyranose[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-26_006290
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-04_003730
- Source: orthology-aragem
- Gene: Ec-17_000840
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: