Difference between revisions of "Ec-08 004280"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4 CPD-4] == * smiles: ** C(OP([O-])(=O)[O-])C1(C([S-])=C(S)[CH]2([CH](O1)NC3(=C(N2)C(=O)NC(...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5697 PWY-5697] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4 CPD-4] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5697 PWY-5697] ==
−
* smiles:
+
* taxonomic range:
−
** C(OP([O-])(=O)[O-])C1(C([S-])=C(S)[CH]2([CH](O1)NC3(=C(N2)C(=O)NC(N)=N3)))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
** InChIKey=HPEUEJRPDGMIMY-IFQPEPLCSA-K
+
 
* common name:
 
* common name:
−
** molybdopterin
+
** allantoin degradation to ureidoglycolate I (urea producing)
−
* molecular weight:
+
−
** 392.321   
+
 
* Synonym(s):
 
* Synonym(s):
−
** MPT
 
−
** pyranopterin-dithiolate
 
−
** ene-dithiol pyranopterin
 
−
** H2Dtpp-mP
 
−
** [(5aR,8R,9aR)-2-amino-4-oxo-6,7-disulfanyl-3,5,5a,8,9a,10-hexahydro-4H-pyrano[3,2-g]pteridin-8-yl]methyl dihydrogen phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-8344]]
+
'''2''' reactions found over '''2''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[ALLANTOICASE-RXN]]
−
* [[RXN-8342]]
+
** 1 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-06_010130]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[ALLANTOINASE-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2759}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266731 45266731]
+
{{#set: taxonomic range=TAX-2}}
−
* CHEBI:
+
{{#set: common name=allantoin degradation to ureidoglycolate I (urea producing)}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58698 58698]
+
{{#set: reaction found=2}}
−
* LIGAND-CPD:
+
{{#set: total reaction=2}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05924 C05924]
+
{{#set: completion rate=100.0}}
−
* HMDB : HMDB02206
+
−
{{#set: smiles=C(OP([O-])(=O)[O-])C1(C([S-])=C(S)[CH]2([CH](O1)NC3(=C(N2)C(=O)NC(N)=N3)))}}
+
−
{{#set: inchi key=InChIKey=HPEUEJRPDGMIMY-IFQPEPLCSA-K}}
+
−
{{#set: common name=molybdopterin}}
+
−
{{#set: molecular weight=392.321    }}
+
−
{{#set: common name=MPT|pyranopterin-dithiolate|ene-dithiol pyranopterin|H2Dtpp-mP|[(5aR,8R,9aR)-2-amino-4-oxo-6,7-disulfanyl-3,5,5a,8,9a,10-hexahydro-4H-pyrano[3,2-g]pteridin-8-yl]methyl dihydrogen phosphate}}
+
−
{{#set: consumed by=RXN-8344}}
+
−
{{#set: produced by=RXN-8342}}
+

Revision as of 13:33, 21 March 2018

Pathway PWY-5697

  • taxonomic range:
  • common name:
    • allantoin degradation to ureidoglycolate I (urea producing)
  • Synonym(s):

Reaction(s) found

2 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-08_004280&oldid=19554"