Difference between revisions of "DIHYDROXY-ACETONE-PHOSPHATE"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6932 PWY-6932] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11674 CPD-11674] == * smiles: ** C(O)CC1(=CNC2(=C1C=C(OS(=O)(=O)[O-])C=C2)) * inchi key: **...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11674 CPD-11674] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C(O)CC1(=CNC2(=C1C=C(OS(=O)(=O)[O-])C=C2)) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=FOCUAJYUOXSNDS-UHFFFAOYSA-M |
* common name: | * common name: | ||
| − | ** | + | ** 5-hydroxytryptophol sulfate |
| + | * molecular weight: | ||
| + | ** 256.253 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 5-hydroxytryptophol sulphate |
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-10782]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237265 44237265] | |
| − | ** [http:// | + | {{#set: smiles=C(O)CC1(=CNC2(=C1C=C(OS(=O)(=O)[O-])C=C2))}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=FOCUAJYUOXSNDS-UHFFFAOYSA-M}} |
| − | {{#set: | + | {{#set: common name=5-hydroxytryptophol sulfate}} |
| − | {{#set: | + | {{#set: molecular weight=256.253 }} |
| − | {{#set: | + | {{#set: common name=5-hydroxytryptophol sulphate}} |
| − | {{#set: common name | + | {{#set: produced by=RXN-10782}} |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
Revision as of 13:33, 21 March 2018
Contents
Metabolite CPD-11674
- smiles:
- C(O)CC1(=CNC2(=C1C=C(OS(=O)(=O)[O-])C=C2))
- inchi key:
- InChIKey=FOCUAJYUOXSNDS-UHFFFAOYSA-M
- common name:
- 5-hydroxytryptophol sulfate
- molecular weight:
- 256.253
- Synonym(s):
- 5-hydroxytryptophol sulphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(O)CC1(=CNC2(=C1C=C(OS(=O)(=O)[O-])C=C2))" cannot be used as a page name in this wiki.
