Difference between revisions of "L-ASPARTATE-SEMIALDEHYDE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10277 CPD-10277] == * smiles: ** CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C * inchi key: ** InChIK...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5078 PWY-5078] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5078 PWY-5078] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** L-isoleucine degradation II |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** Ehrlich pathway |
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN- | + | '''1''' reactions found over '''3''' reactions in the full pathway |
| − | + | * [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]] | |
| − | * [[ | + | ** 5 associated gene(s): |
| − | == Reaction(s) | + | *** [[Ec-20_001390]] |
| + | *** [[Ec-12_005520]] | ||
| + | *** [[Ec-12_005560]] | ||
| + | *** [[Ec-01_007170]] | ||
| + | *** [[Ec-12_005530]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | *** [[orthology-aragem]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=4.1.1.72-RXN 4.1.1.72-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-7694 RXN-7694] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-4751}} | |
| − | + | {{#set: common name=L-isoleucine degradation II}} | |
| − | + | {{#set: common name=Ehrlich pathway}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=3}} | |
| − | + | {{#set: completion rate=33.0}} | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Revision as of 14:33, 21 March 2018
Pathway PWY-5078
- taxonomic range:
- common name:
- L-isoleucine degradation II
- Synonym(s):
- Ehrlich pathway
Reaction(s) found
1 reactions found over 3 reactions in the full pathway
- BRANCHED-CHAINAMINOTRANSFERILEU-RXN
- 5 associated gene(s):
- 2 reconstruction source(s) associated:
