Difference between revisions of "Ec-25 000050"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] == * smiles: ** C1(C(O)CC(=NC1C([O-])=O)C([O-])=O) * inchi key: ** InChIKe...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=5.99.1.2-RXN 5.99.1.2-RXN] == * direction: ** REVERSIBLE * common name: ** DNA topoisomerase ** DNA...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=5.99.1.2-RXN 5.99.1.2-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** DNA topoisomerase |
− | * | + | ** DNA topoisomerase type I |
− | ** | + | ** Spo11/DNA topoisomerase VI subunit A |
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/5.99.1.2 EC-5.99.1.2] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[Negatively-super-coiled-DNAs]][c] '''<=>''' 1 [[Relaxed-DNAs]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 a negatively supercoiled DNA[c] '''<=>''' 1 a relaxed DNA[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-24_003570]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Ec-01_011320]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-12_007130]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-15_001600]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-01_011310]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-08_003340]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-03_004560]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Ec-12_007190]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-03_001530]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * UNIPROT: |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/Q7M0H8 Q7M0H8] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q07050 Q07050] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9JWZ5 Q9JWZ5] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q59046 Q59046] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9PLZ2 Q9PLZ2] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/P47368 P47368] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9CG80 Q9CG80] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P43704 P43704] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P43012 P43012] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P0A620 P0A620] |
+ | ** [http://www.uniprot.org/uniprot/P04786 P04786] | ||
+ | ** [http://www.uniprot.org/uniprot/P13099 P13099] | ||
+ | ** [http://www.uniprot.org/uniprot/P06612 P06612] | ||
+ | ** [http://www.uniprot.org/uniprot/P11387 P11387] | ||
+ | ** [http://www.uniprot.org/uniprot/P07799 P07799] | ||
+ | ** [http://www.uniprot.org/uniprot/P93119 P93119] | ||
+ | ** [http://www.uniprot.org/uniprot/O13463 O13463] | ||
+ | ** [http://www.uniprot.org/uniprot/Q94705 Q94705] | ||
+ | ** [http://www.uniprot.org/uniprot/Q04750 Q04750] | ||
+ | ** [http://www.uniprot.org/uniprot/P14294 P14294] | ||
+ | ** [http://www.uniprot.org/uniprot/P30181 P30181] | ||
+ | ** [http://www.uniprot.org/uniprot/P34185 P34185] | ||
+ | ** [http://www.uniprot.org/uniprot/P30189 P30189] | ||
+ | ** [http://www.uniprot.org/uniprot/P40114 P40114] | ||
+ | ** [http://www.uniprot.org/uniprot/P41511 P41511] | ||
+ | ** [http://www.uniprot.org/uniprot/Q8I3Z9 Q8I3Z9] | ||
+ | ** [http://www.uniprot.org/uniprot/Q26024 Q26024] | ||
+ | ** [http://www.uniprot.org/uniprot/Q27529 Q27529] | ||
+ | ** [http://www.uniprot.org/uniprot/P41512 P41512] | ||
+ | ** [http://www.uniprot.org/uniprot/O24307 O24307] | ||
+ | ** [http://www.uniprot.org/uniprot/P71196 P71196] | ||
+ | ** [http://www.uniprot.org/uniprot/O70157 O70157] | ||
+ | ** [http://www.uniprot.org/uniprot/O60126 O60126] | ||
+ | ** [http://www.uniprot.org/uniprot/O61660 O61660] | ||
+ | {{#set: direction=REVERSIBLE}} | ||
+ | {{#set: common name=DNA topoisomerase}} | ||
+ | {{#set: common name=DNA topoisomerase type I}} | ||
+ | {{#set: common name=Spo11/DNA topoisomerase VI subunit A}} | ||
+ | {{#set: ec number=EC-5.99.1.2}} | ||
+ | {{#set: gene associated=Ec-24_003570|Ec-01_011320|Ec-12_007130|Ec-15_001600|Ec-01_011310|Ec-08_003340|Ec-03_004560|Ec-12_007190|Ec-03_001530}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Revision as of 13:33, 21 March 2018
Contents
Reaction 5.99.1.2-RXN
- direction:
- REVERSIBLE
- common name:
- DNA topoisomerase
- DNA topoisomerase type I
- Spo11/DNA topoisomerase VI subunit A
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Negatively-super-coiled-DNAs[c] <=> 1 Relaxed-DNAs[c]
- With common name(s):
- 1 a negatively supercoiled DNA[c] <=> 1 a relaxed DNA[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-24_003570
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
- Gene: Ec-01_011320
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-12_007130
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-15_001600
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-01_011310
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-08_003340
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-03_004560
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
- Gene: Ec-12_007190
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-03_001530
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- UNIPROT: