Difference between revisions of "CPD-15016"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15590 CPD-15590] == * smiles: ** [CH](=O)C(C(C(C(CO)O)O)O)O * inchi key: ** InChIKey=GZCGUP...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=H2CO3 H2CO3] == * smiles: ** C(O)(=O)O * inchi key: ** InChIKey=BVKZGUZCCUSVTD-UHFFFAOYSA-N * c...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=H2CO3 H2CO3] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(O)(=O)O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=BVKZGUZCCUSVTD-UHFFFAOYSA-N |
* common name: | * common name: | ||
| − | ** | + | ** carbonic acid |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 62.025 |
* Synonym(s): | * Synonym(s): | ||
| + | ** H2CO3 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[CARBODEHYDRAT-RXN]] |
== External links == | == External links == | ||
| + | * CAS : 463-79-6 | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=767 767] | ||
| + | * HMDB : HMDB03538 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01353 C01353] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.747.html 747] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28976 28976] |
| − | + | {{#set: smiles=C(O)(=O)O}} | |
| − | + | {{#set: inchi key=InChIKey=BVKZGUZCCUSVTD-UHFFFAOYSA-N}} | |
| − | {{#set: smiles= | + | {{#set: common name=carbonic acid}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: molecular weight=62.025 }} |
| − | {{#set: common name= | + | {{#set: common name=H2CO3}} |
| − | {{#set: molecular weight= | + | {{#set: reversible reaction associated=CARBODEHYDRAT-RXN}} |
| − | {{#set: reversible reaction associated= | + | |
Revision as of 13:34, 21 March 2018
Contents
Metabolite H2CO3
- smiles:
- C(O)(=O)O
- inchi key:
- InChIKey=BVKZGUZCCUSVTD-UHFFFAOYSA-N
- common name:
- carbonic acid
- molecular weight:
- 62.025
- Synonym(s):
- H2CO3
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
