Difference between revisions of "PYRIDNUCSYN-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4187 CPD-4187] == * smiles: ** CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C...")
 
(Created page with "Category:Gene == Gene Ec-02_005270 == * left end position: ** 5545946 * transcription direction: ** POSITIVE * right end position: ** 5547980 * centisome position: ** 84.9...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4187 CPD-4187] ==
+
== Gene Ec-02_005270 ==
−
* smiles:
+
* left end position:
−
** CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C4))))
+
** 5545946
−
* inchi key:
+
* transcription direction:
−
** InChIKey=UCTLRSWJYQTBFZ-DDPQNLDTSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 7-dehydrocholesterol
+
** 5547980
−
* molecular weight:
+
* centisome position:
−
** 384.644    
+
** 84.959    
 
* Synonym(s):
 
* Synonym(s):
−
** cholesta-5,7-dien-3 β-ol
+
** Esi_0024_0153
−
** cholesta-5,7-dienol
+
** Esi0024_0153
−
** 7-dehydro-cholesterol
+
−
** cholesta-5,7-dien-3β-ol
+
−
** provitamin D3
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN66-323]]
+
* [[GLYOXIII-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
* [[1.14.21.6-RXN]]
+
***automated-name-match
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* CAS : 434-16-2
+
{{#set: left end position=5545946}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201813 25201813]
+
{{#set: right end position=5547980}}
−
* CHEBI:
+
{{#set: centisome position=84.959   }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17759 17759]
+
{{#set: common name=Esi_0024_0153|Esi0024_0153}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=GLYOXIII-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01164 C01164]
+
−
* HMDB : HMDB00032
+
−
{{#set: smiles=CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C4))))}}
+
−
{{#set: inchi key=InChIKey=UCTLRSWJYQTBFZ-DDPQNLDTSA-N}}
+
−
{{#set: common name=7-dehydrocholesterol}}
+
−
{{#set: molecular weight=384.644   }}
+
−
{{#set: common name=cholesta-5,7-dien-3 β-ol|cholesta-5,7-dienol|7-dehydro-cholesterol|cholesta-5,7-dien-3β-ol|provitamin D3}}
+
−
{{#set: consumed by=RXN66-323}}
+
−
{{#set: produced by=1.14.21.6-RXN}}
+

Revision as of 20:39, 17 March 2018

Gene Ec-02_005270

  • left end position:
    • 5545946
  • transcription direction:
    • POSITIVE
  • right end position:
    • 5547980
  • centisome position:
    • 84.959
  • Synonym(s):
    • Esi_0024_0153
    • Esi0024_0153

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PYRIDNUCSYN-PWY&oldid=9836"