Difference between revisions of "PRODISULFREDUCT-A-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2108 CPD0-2108] == * smiles: ** CCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-]...")
(Created page with "Category:Gene == Gene Ec-25_001360 == * left end position: ** 1595485 * transcription direction: ** POSITIVE * right end position: ** 1608476 * centisome position: ** 35.8...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2108 CPD0-2108] ==
+
== Gene Ec-25_001360 ==
−
* smiles:
+
* left end position:
−
** CCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O
+
** 1595485
−
* inchi key:
+
* transcription direction:
−
** InChIKey=CPSDNAXXKWVYIY-NTLMCJQISA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** trans-oct-2-enoyl-CoA
+
** 1608476
−
* molecular weight:
+
* centisome position:
−
** 887.685    
+
** 35.84604    
 
* Synonym(s):
 
* Synonym(s):
−
** (2E)-octenoyl-CoA
+
** Esi_0173_0060
−
** trans-2-octenoyl-coenzyme A
+
** Esi0173_0060
−
** 3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-2,2-dimethyl-4-({3-[(2-{[(2E)-oct-2-enoyl]sulfanyl}ethyl)amino]-3-oxopropyl}amino)-4-oxobutyl] dihydrogen diphosphate}
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[FUMHYDR-RXN]]
−
* [[RXN-12669]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-561]]
 +
* [[PWY-5913]]
 +
* [[P42-PWY]]
 +
* [[PWY-7384]]
 +
* [[PWY-5392]]
 +
* [[TCA]]
 +
* [[P23-PWY]]
 +
* [[P105-PWY]]
 +
* [[FERMENTATION-PWY]]
 +
* [[PWY-6728]]
 +
* [[REDCITCYC]]
 +
* [[PWY-7254]]
 +
* [[P108-PWY]]
 +
* [[PWY-5690]]
 +
* [[PWY66-398]]
 +
* [[PWY-6969]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: left end position=1595485}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05276 C05276]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=1608476}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62242 62242]
+
{{#set: centisome position=35.84604    }}
−
* BIGG : 45482
+
{{#set: common name=Esi_0173_0060|Esi0173_0060}}
−
* PUBCHEM:
+
{{#set: reaction associated=FUMHYDR-RXN}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173358 46173358]
+
{{#set: pathway associated=PWY-561|PWY-5913|P42-PWY|PWY-7384|PWY-5392|TCA|P23-PWY|P105-PWY|FERMENTATION-PWY|PWY-6728|REDCITCYC|PWY-7254|P108-PWY|PWY-5690|PWY66-398|PWY-6969}}
−
* HMDB : HMDB03949
+
−
{{#set: smiles=CCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O}}
+
−
{{#set: inchi key=InChIKey=CPSDNAXXKWVYIY-NTLMCJQISA-J}}
+
−
{{#set: common name=trans-oct-2-enoyl-CoA}}
+
−
{{#set: molecular weight=887.685    }}
+
−
{{#set: common name=(2E)-octenoyl-CoA|trans-2-octenoyl-coenzyme A|3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-2,2-dimethyl-4-({3-[(2-{[(2E)-oct-2-enoyl]sulfanyl}ethyl)amino]-3-oxopropyl}amino)-4-oxobutyl] dihydrogen diphosphate}}}
+
−
{{#set: produced by=RXN-12669}}
+

Revision as of 13:35, 21 March 2018

Gene Ec-25_001360

  • left end position:
    • 1595485
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1608476
  • centisome position:
    • 35.84604
  • Synonym(s):
    • Esi_0173_0060
    • Esi0173_0060

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PRODISULFREDUCT-A-RXN&oldid=19918"