Difference between revisions of "IDP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-METHYL-MYO-INOSITOL 4-METHYL-MYO-INOSITOL] == * smiles: ** COC1(C(O)C(O)C(O)C(O)C(O)1) * inch...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5870 PWY-5870] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4890 TAX-48...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-METHYL-MYO-INOSITOL 4-METHYL-MYO-INOSITOL] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5870 PWY-5870] ==
−
* smiles:
+
* taxonomic range:
−
** COC1(C(O)C(O)C(O)C(O)C(O)1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4890 TAX-4890]
−
* inchi key:
+
−
** InChIKey=DSCFFEYYQKSRSV-GESKJZQWSA-N
+
 
* common name:
 
* common name:
−
** D-ononitol
+
** ubiquinol-8 biosynthesis (eukaryotic)
−
* molecular weight:
+
−
** 194.184   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 4-O-methyl-myo-inositol
+
** ubiquinone-8 biosynthesis (eukaryotic)
−
** ononitol
+
−
** 1D-4-O-methyl-myo-inositol
+
−
** 4-methyl-myo-inositol
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-8281]]
+
'''2''' reactions found over '''9''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Ec-08_006620]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Ec-24_003910]]
 +
*** [[Ec-00_007360]]
 +
*** [[Ec-00_007350]]
 +
*** [[Ec-25_002110]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=2-OCTAPRENYL-6-METHOXYPHENOL-HYDROX-RXN 2-OCTAPRENYL-6-METHOXYPHENOL-HYDROX-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=CHORPYRLY-RXN CHORPYRLY-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=DHHB-METHYLTRANSFER-RXN DHHB-METHYLTRANSFER-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=OCTAPRENYL-METHYL-METHOXY-BENZOQ-OH-RXN OCTAPRENYL-METHYL-METHOXY-BENZOQ-OH-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9277 RXN-9277]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9280 RXN-9280]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9283 RXN-9283]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-4890}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06352 C06352]
+
{{#set: common name=ubiquinol-8 biosynthesis (eukaryotic)}}
−
* CHEBI:
+
{{#set: common name=ubiquinone-8 biosynthesis (eukaryotic)}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18266 18266]
+
{{#set: reaction found=2}}
−
* PUBCHEM:
+
{{#set: total reaction=9}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12300199 12300199]
+
{{#set: completion rate=22.0}}
−
* HMDB : HMDB29915
+
−
{{#set: smiles=COC1(C(O)C(O)C(O)C(O)C(O)1)}}
+
−
{{#set: inchi key=InChIKey=DSCFFEYYQKSRSV-GESKJZQWSA-N}}
+
−
{{#set: common name=D-ononitol}}
+
−
{{#set: molecular weight=194.184    }}
+
−
{{#set: common name=4-O-methyl-myo-inositol|ononitol|1D-4-O-methyl-myo-inositol|4-methyl-myo-inositol}}
+
−
{{#set: consumed by=RXN-8281}}
+

Revision as of 13:35, 21 March 2018

Pathway PWY-5870

  • taxonomic range:
  • common name:
    • ubiquinol-8 biosynthesis (eukaryotic)
  • Synonym(s):
    • ubiquinone-8 biosynthesis (eukaryotic)

Reaction(s) found

2 reactions found over 9 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=IDP&oldid=19985"