Difference between revisions of "Ec-17 002250"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11281 CPD-11281] == * smiles: ** C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O * inchi k...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6587 PWY-6587] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6587 PWY-6587] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** pyruvate fermentation to ethanol III |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''1''' reactions found over '''3''' reactions in the full pathway | |
− | * [[ | + | * [[PYRUFLAVREDUCT-RXN]] |
− | == Reaction(s) | + | ** 3 associated gene(s): |
− | * [ | + | *** [[Ec-18_003420]] |
+ | *** [[Ec-15_004230]] | ||
+ | *** [[Ec-23_002710]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=ACETALD-DEHYDROG-RXN ACETALD-DEHYDROG-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=ALCOHOL-DEHYDROG-RXN ALCOHOL-DEHYDROG-RXN] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=pyruvate fermentation to ethanol III}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=3}} | |
− | + | {{#set: completion rate=33.0}} | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 13:36, 21 March 2018
Pathway PWY-6587
- taxonomic range:
- common name:
- pyruvate fermentation to ethanol III
- Synonym(s):
Reaction(s) found
1 reactions found over 3 reactions in the full pathway
- PYRUFLAVREDUCT-RXN
- 3 associated gene(s):
- 1 reconstruction source(s) associated: