Difference between revisions of "RXN-14189"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUMP DUMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2)) * inchi key: **...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5114 RXN0-5114] == * direction: ** LEFT-TO-RIGHT * common name: ** HAD-like domain * ec number...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUMP DUMP] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5114 RXN0-5114] ==
−
* smiles:
+
* direction:
−
** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=JSRLJPSBLDHEIO-SHYZEUOFSA-L
+
 
* common name:
 
* common name:
−
** dUMP
+
** HAD-like domain
−
* molecular weight:
+
* ec number:
−
** 306.168   
+
** [http://enzyme.expasy.org/EC/3.1.3.3 EC-3.1.3.3]
 
* Synonym(s):
 
* Synonym(s):
−
** U
 
−
** deoxyurdine-phosphate
 
−
** 2'-deoxyuridine 5-monophosphate
 
−
** deoxyuridine-phosphate
 
−
** 2'-deoxyuridine 5'-phosphate
 
−
** 2'-deoxyuridylic acid
 
−
** 2'-deoxy-5'-uridylic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[THYMIDYLATESYN-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[3-P-SERINE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[SER]][c] '''+''' 1 [[Pi]][c]
−
* [[DUTP-PYROP-RXN]]
+
* With common name(s):
−
* [[RXN-14199]]
+
** 1 3-phospho-L-serine[c] '''+''' 1 H2O[c] '''=>''' 1 L-serine[c] '''+''' 1 phosphate[c]
−
* [[DCMP-DEAMINASE-RXN]]
+
 
−
== Reaction(s) of unknown directionality ==
+
== Genes associated with this reaction  ==
−
* [[RXN-14220]]
+
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-18_001570]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[SERSYN-PWY]], L-serine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=SERSYN-PWY SERSYN-PWY]
 +
** '''3''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 964-26-1
+
* RHEA:
−
* BIGG : 34762
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21208 21208]
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=18601100 18601100]
+
** [http://www.genome.jp/dbget-bin/www_bget?R00582 R00582]
−
* HMDB : HMDB01409
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* LIGAND-CPD:
+
{{#set: common name=HAD-like domain}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00365 C00365]
+
{{#set: ec number=EC-3.1.3.3}}
−
* CHEMSPIDER:
+
{{#set: gene associated=Ec-18_001570}}
−
** [http://www.chemspider.com/Chemical-Structure.18555972.html 18555972]
+
{{#set: in pathway=SERSYN-PWY}}
−
* CHEBI:
+
{{#set: reconstruction category=orthology|annotation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=246422 246422]
+
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
−
* METABOLIGHTS : MTBLC246422
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2))}}
+
−
{{#set: inchi key=InChIKey=JSRLJPSBLDHEIO-SHYZEUOFSA-L}}
+
−
{{#set: common name=dUMP}}
+
−
{{#set: molecular weight=306.168    }}
+
−
{{#set: common name=U|deoxyurdine-phosphate|2'-deoxyuridine 5-monophosphate|deoxyuridine-phosphate|2'-deoxyuridine 5'-phosphate|2'-deoxyuridylic acid|2'-deoxy-5'-uridylic acid}}
+
−
{{#set: consumed by=THYMIDYLATESYN-RXN}}
+
−
{{#set: produced by=DUTP-PYROP-RXN|RXN-14199|DCMP-DEAMINASE-RXN}}
+
−
{{#set: reversible reaction associated=RXN-14220}}
+

Revision as of 13:36, 21 March 2018

Reaction RXN0-5114

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • HAD-like domain
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 3-phospho-L-serine[c] + 1 H2O[c] => 1 L-serine[c] + 1 phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • SERSYN-PWY, L-serine biosynthesis: SERSYN-PWY
    • 3 reactions found over 3 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-14189&oldid=20013"