Difference between revisions of "PHOSNACMURPENTATRANS-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOXYL INDOXYL] == * smiles: ** C2(C=CC1(=C(C(O)=CN1)C=2)) * inchi key: ** InChIKey=PCKPVGOLPK...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7214 PWY-7214] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7214 PWY-7214] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** baicalein degradation (hydrogen peroxide detoxification) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''1''' reactions found over '''2''' reactions in the full pathway | |
− | == Reaction(s) | + | * [[RXN-14240]] |
− | * [ | + | ** 30 associated gene(s): |
+ | *** [[Ec-20_002770]] | ||
+ | *** [[Ec-02_001880]] | ||
+ | *** [[Ec-02_001740]] | ||
+ | *** [[Ec-04_004690]] | ||
+ | *** [[Ec-00_008240]] | ||
+ | *** [[Ec-00_008250]] | ||
+ | *** [[Ec-00_008220]] | ||
+ | *** [[Ec-14_002880]] | ||
+ | *** [[Ec-05_003380]] | ||
+ | *** [[Ec-02_000470]] | ||
+ | *** [[Ec-19_000230]] | ||
+ | *** [[Ec-02_001210]] | ||
+ | *** [[Ec-27_004950]] | ||
+ | *** [[Ec-26_000310]] | ||
+ | *** [[Ec-11_003410]] | ||
+ | *** [[Ec-00_010030]] | ||
+ | *** [[Ec-00_008210]] | ||
+ | *** [[Ec-11_001530]] | ||
+ | *** [[Ec-16_000240]] | ||
+ | *** [[Ec-08_006020]] | ||
+ | *** [[Ec-05_002520]] | ||
+ | *** [[Ec-28_003740]] | ||
+ | *** [[Ec-24_002030]] | ||
+ | *** [[Ec-17_002430]] | ||
+ | *** [[Ec-24_002370]] | ||
+ | *** [[Ec-19_001450]] | ||
+ | *** [[Ec-17_002450]] | ||
+ | *** [[Ec-06_003550]] | ||
+ | *** [[Ec-02_003170]] | ||
+ | *** [[Ec-14_006530]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11760 RXN-11760] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: common name=baicalein degradation (hydrogen peroxide detoxification)}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=2}} | |
− | + | {{#set: completion rate=50.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 13:36, 21 March 2018
Pathway PWY-7214
- taxonomic range:
- common name:
- baicalein degradation (hydrogen peroxide detoxification)
- Synonym(s):
Reaction(s) found
1 reactions found over 2 reactions in the full pathway
- RXN-14240
- 30 associated gene(s):
- Ec-20_002770
- Ec-02_001880
- Ec-02_001740
- Ec-04_004690
- Ec-00_008240
- Ec-00_008250
- Ec-00_008220
- Ec-14_002880
- Ec-05_003380
- Ec-02_000470
- Ec-19_000230
- Ec-02_001210
- Ec-27_004950
- Ec-26_000310
- Ec-11_003410
- Ec-00_010030
- Ec-00_008210
- Ec-11_001530
- Ec-16_000240
- Ec-08_006020
- Ec-05_002520
- Ec-28_003740
- Ec-24_002030
- Ec-17_002430
- Ec-24_002370
- Ec-19_001450
- Ec-17_002450
- Ec-06_003550
- Ec-02_003170
- Ec-14_006530
- 1 reconstruction source(s) associated:
- 30 associated gene(s):