Difference between revisions of "TransportSeed COB-I-ALAMIN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-PARATHION AMINO-PARATHION] == * smiles: ** CCOP(OC1(C=CC(=CC=1)N))(OCC)=S * inchi key: **...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5084 PWY-5084] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5084 PWY-5084] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
* common name: | * common name: | ||
− | ** | + | ** 2-oxoglutarate decarboxylation to succinyl-CoA |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 2-oxoglutarate dehydrogenase complex | ||
+ | ** 2-ketoglutarate dehydrogenase complex | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''3''' reactions found over '''3''' reactions in the full pathway |
− | + | * [[2OXOGLUTDECARB-RXN]] | |
− | == Reaction(s) | + | ** 4 associated gene(s): |
+ | *** [[Ec-25_000020]] | ||
+ | *** [[Ec-21_002310]] | ||
+ | *** [[Ec-21_002300]] | ||
+ | *** [[Ec-27_004160]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-7716]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Ec-21_002300]] | ||
+ | *** [[Ec-27_004160]] | ||
+ | *** [[Ec-25_000020]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN0-1147]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Ec-25_000020]] | ||
+ | *** [[Ec-21_002300]] | ||
+ | *** [[Ec-27_004160]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-5084 PWY-5084] |
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: taxonomic range=TAX-2157}} | |
− | {{#set: | + | {{#set: common name=2-oxoglutarate decarboxylation to succinyl-CoA}} |
− | {{#set: | + | {{#set: common name=2-oxoglutarate dehydrogenase complex|2-ketoglutarate dehydrogenase complex}} |
− | {{#set: common name= | + | {{#set: reaction found=3}} |
− | {{#set: | + | {{#set: total reaction=3}} |
− | {{#set: | + | {{#set: completion rate=100.0}} |
Revision as of 13:36, 21 March 2018
Pathway PWY-5084
- taxonomic range:
- common name:
- 2-oxoglutarate decarboxylation to succinyl-CoA
- Synonym(s):
- 2-oxoglutarate dehydrogenase complex
- 2-ketoglutarate dehydrogenase complex
Reaction(s) found
3 reactions found over 3 reactions in the full pathway
- 2OXOGLUTDECARB-RXN
- 4 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-7716
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN0-1147
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: