Difference between revisions of "Ec-05 001290"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-05_000630 == * left end position: ** 1426998 * transcription direction: ** POSITIVE * right end position: ** 1440821 * centisome position: ** 15.6...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUMP DUMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2)) * inchi key: **...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUMP DUMP] == |
− | * | + | * smiles: |
− | ** | + | ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2)) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=JSRLJPSBLDHEIO-SHYZEUOFSA-L |
− | * | + | * common name: |
− | ** | + | ** dUMP |
− | * | + | * molecular weight: |
− | ** | + | ** 306.168 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** U |
− | ** | + | ** deoxyurdine-phosphate |
− | ** | + | ** 2'-deoxyuridine 5-monophosphate |
+ | ** deoxyuridine-phosphate | ||
+ | ** 2'-deoxyuridine 5'-phosphate | ||
+ | ** 2'-deoxyuridylic acid | ||
+ | ** 2'-deoxy-5'-uridylic acid | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[THYMIDYLATESYN-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[DUTP-PYROP-RXN]] | |
− | == | + | * [[RXN-14199]] |
− | * [[ | + | * [[DCMP-DEAMINASE-RXN]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | * [[ | + | * [[RXN-14220]] |
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 964-26-1 |
− | {{#set: | + | * BIGG : 34762 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=18601100 18601100] |
− | {{#set: common name= | + | * HMDB : HMDB01409 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00365 C00365] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.18555972.html 18555972] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=246422 246422] | ||
+ | * METABOLIGHTS : MTBLC246422 | ||
+ | {{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2))}} | ||
+ | {{#set: inchi key=InChIKey=JSRLJPSBLDHEIO-SHYZEUOFSA-L}} | ||
+ | {{#set: common name=dUMP}} | ||
+ | {{#set: molecular weight=306.168 }} | ||
+ | {{#set: common name=U|deoxyurdine-phosphate|2'-deoxyuridine 5-monophosphate|deoxyuridine-phosphate|2'-deoxyuridine 5'-phosphate|2'-deoxyuridylic acid|2'-deoxy-5'-uridylic acid}} | ||
+ | {{#set: consumed by=THYMIDYLATESYN-RXN}} | ||
+ | {{#set: produced by=DUTP-PYROP-RXN|RXN-14199|DCMP-DEAMINASE-RXN}} | ||
+ | {{#set: reversible reaction associated=RXN-14220}} |
Revision as of 13:36, 21 March 2018
Contents
Metabolite DUMP
- smiles:
- C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2))
- inchi key:
- InChIKey=JSRLJPSBLDHEIO-SHYZEUOFSA-L
- common name:
- dUMP
- molecular weight:
- 306.168
- Synonym(s):
- U
- deoxyurdine-phosphate
- 2'-deoxyuridine 5-monophosphate
- deoxyuridine-phosphate
- 2'-deoxyuridine 5'-phosphate
- 2'-deoxyuridylic acid
- 2'-deoxy-5'-uridylic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 964-26-1
- BIGG : 34762
- PUBCHEM:
- HMDB : HMDB01409
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC246422
"C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2))" cannot be used as a page name in this wiki.