Difference between revisions of "PWY-5268"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12905 CPD-12905] == * smiles: ** CC(C)=CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O...")
(Created page with "Category:Gene == Gene Ec-18_001420 == * left end position: ** 1352912 * transcription direction: ** POSITIVE * right end position: ** 1355875 * centisome position: ** 27.4...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12905 CPD-12905] ==
+
== Gene Ec-18_001420 ==
−
* smiles:
+
* left end position:
−
** CC(C)=CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 1352912
−
* inchi key:
+
* transcription direction:
−
** InChIKey=OLZYNLSKRKFUJC-FPVIQYCMSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 3-hydroxy-5-methylhex-4-enoyl-CoA
+
** 1355875
−
* molecular weight:
+
* centisome position:
−
** 889.657    
+
** 27.461613    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0269_0016
 +
** Esi0269_0016
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN0-5021]]
−
* [[RXN-11919]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1352912}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986102 50986102]
+
{{#set: transcription direction=POSITIVE}}
−
* LIGAND-CPD:
+
{{#set: right end position=1355875}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16469 C16469]
+
{{#set: centisome position=27.461613    }}
−
* HMDB : HMDB60373
+
{{#set: common name=Esi_0269_0016|Esi0269_0016}}
−
{{#set: smiles=CC(C)=CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction associated=RXN0-5021}}
−
{{#set: inchi key=InChIKey=OLZYNLSKRKFUJC-FPVIQYCMSA-J}}
+
−
{{#set: common name=3-hydroxy-5-methylhex-4-enoyl-CoA}}
+
−
{{#set: molecular weight=889.657    }}
+
−
{{#set: produced by=RXN-11919}}
+

Revision as of 13:37, 21 March 2018

Gene Ec-18_001420

  • left end position:
    • 1352912
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1355875
  • centisome position:
    • 27.461613
  • Synonym(s):
    • Esi_0269_0016
    • Esi0269_0016

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-5268&oldid=20153"