Difference between revisions of "2-KETO-3-DEOXY-6-P-GLUCONATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DI-H-OROTATE DI-H-OROTATE] == * smiles: ** C1(C(=O)NC(=O)NC(C(=O)[O-])1) * inchi key: ** InChIK...") |
(Created page with "Category:Gene == Gene Ec-03_004790 == * left end position: ** 5683400 * transcription direction: ** POSITIVE * right end position: ** 5694615 * centisome position: ** 87.0...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-03_004790 == |
− | * | + | * left end position: |
− | ** | + | ** 5683400 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 5694615 |
− | * | + | * centisome position: |
− | ** | + | ** 87.05307 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0050_0061 |
− | ** | + | ** Esi0050_0061 |
− | ** | + | ** GRX |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[RXN-982]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * | + | *** Assignment: ec-number |
− | == | + | == Pathways associated == |
− | * [[ | + | * [[PWY-4621]] |
− | + | * [[PWY-4202]] | |
− | * [[ | + | |
== External links == | == External links == | ||
− | + | {{#set: left end position=5683400}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=5694615}} | |
− | + | {{#set: centisome position=87.05307 }} | |
− | + | {{#set: common name=Esi_0050_0061|Esi0050_0061|GRX}} | |
− | + | {{#set: reaction associated=RXN-982}} | |
− | + | {{#set: pathway associated=PWY-4621|PWY-4202}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 13:37, 21 March 2018
Gene Ec-03_004790
- left end position:
- 5683400
- transcription direction:
- POSITIVE
- right end position:
- 5694615
- centisome position:
- 87.05307
- Synonym(s):
- Esi_0050_0061
- Esi0050_0061
- GRX
Reactions associated
- Reaction: RXN-982
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome