Difference between revisions of "Ec-10 000640"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CREATINASE-RXN CREATINASE-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Creatinase/Aminop...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2751 CPD-2751] == * smiles: ** C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2)) * inchi key: ** InChIKey=...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=CREATINASE-RXN CREATINASE-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2751 CPD-2751] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2))
 +
* inchi key:
 +
** InChIKey=BBNHNZGTKSWIHD-SNVBAGLBSA-N
 
* common name:
 
* common name:
−
** Creatinase/Aminopeptidase P, N-terminal
+
** 5'-hydroxycotinine
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/3.5.3.3 EC-3.5.3.3]
+
** 192.217   
 
* Synonym(s):
 
* Synonym(s):
 +
** allohydroxycotinine
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[WATER]][c] '''+''' 1 [[CREATINE]][c] '''=>''' 1 [[SARCOSINE]][c] '''+''' 1 [[UREA]][c]
+
* [[RXN66-163]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H2O[c] '''+''' 1 creatine[c] '''=>''' 1 sarcosine[c] '''+''' 1 urea[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-06_008580]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[CRNFORCAT-PWY]], creatinine degradation I: [http://metacyc.org/META/NEW-IMAGE?object=CRNFORCAT-PWY CRNFORCAT-PWY]
+
−
** '''1''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22456 22456]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9815515 9815515]
−
* LIGAND-RXN:
+
* CHEMSPIDER:
−
** [http://www.genome.jp/dbget-bin/www_bget?R01566 R01566]
+
** [http://www.chemspider.com/Chemical-Structure.7991265.html 7991265]
−
* UNIPROT:
+
* HMDB : HMDB01427
−
** [http://www.uniprot.org/uniprot/P38487 P38487]
+
{{#set: smiles=C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2))}}
−
** [http://www.uniprot.org/uniprot/P19213 P19213]
+
{{#set: inchi key=InChIKey=BBNHNZGTKSWIHD-SNVBAGLBSA-N}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: common name=5'-hydroxycotinine}}
−
{{#set: common name=Creatinase/Aminopeptidase P, N-terminal}}
+
{{#set: molecular weight=192.217    }}
−
{{#set: ec number=EC-3.5.3.3}}
+
{{#set: common name=allohydroxycotinine}}
−
{{#set: gene associated=Ec-06_008580}}
+
{{#set: produced by=RXN66-163}}
−
{{#set: in pathway=CRNFORCAT-PWY}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+

Revision as of 13:37, 21 March 2018

Metabolite CPD-2751

  • smiles:
    • C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2))
  • inchi key:
    • InChIKey=BBNHNZGTKSWIHD-SNVBAGLBSA-N
  • common name:
    • 5'-hydroxycotinine
  • molecular weight:
    • 192.217
  • Synonym(s):
    • allohydroxycotinine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-10_000640&oldid=20274"