Difference between revisions of "RXN-15044"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18 CPD-18] == * smiles: ** CCCCCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
(Created page with "Category:Gene == Gene Ec-04_004690 == * left end position: ** 4710646 * transcription direction: ** POSITIVE * right end position: ** 4727401 * centisome position: ** 72.3...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18 CPD-18] ==
+
== Gene Ec-04_004690 ==
−
* smiles:
+
* left end position:
−
** CCCCCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 4710646
−
* inchi key:
+
* transcription direction:
−
** InChIKey=YECLLIMZHNYFCK-RRNJGNTNSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** linoleoyl-CoA
+
** 4727401
−
* molecular weight:
+
* centisome position:
−
** 1025.937    
+
** 72.339584    
 
* Synonym(s):
 
* Synonym(s):
−
** cis,cis-octadeca-9,12-dienoyl-CoA
+
** Esi_0037_0140
−
** (9Z,12Z)-octadeca-9,12-dienoyl-CoA
+
** Esi0037_0140
−
** 18:2(n-6)
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[1.14.19.3-RXN]]
+
* Reaction: [[PEROXID-RXN]]
−
* [[RXN-16094]]
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[LINOLEOYL-RXN]]
+
*** Assignment: go-term
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-11329]]
−
* [[RXN-16045]]
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-9601]]
+
*** Assignment: automated-name-match
−
* [[RXN-9673]]
+
* Reaction: [[RXN-14240]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-15288]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-17352]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-8635]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-7214]]
 +
* [[PWY-6824]]
 +
* [[PWY-7445]]
 +
* [[PWY-5469]]
 +
* [[PWY-5466]]
 +
* [[PWY-5461]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4710646}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245440 25245440]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=4727401}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57383 57383]
+
{{#set: centisome position=72.339584   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0037_0140|Esi0037_0140}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02050 C02050]
+
{{#set: reaction associated=PEROXID-RXN|RXN-11329|RXN-14240|RXN-15288|RXN-17352|RXN-8635}}
−
* HMDB : HMDB01064
+
{{#set: pathway associated=PWY-7214|PWY-6824|PWY-7445|PWY-5469|PWY-5466|PWY-5461}}
−
{{#set: smiles=CCCCCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=YECLLIMZHNYFCK-RRNJGNTNSA-J}}
+
−
{{#set: common name=linoleoyl-CoA}}
+
−
{{#set: molecular weight=1025.937   }}
+
−
{{#set: common name=cis,cis-octadeca-9,12-dienoyl-CoA|(9Z,12Z)-octadeca-9,12-dienoyl-CoA|18:2(n-6)}}
+
−
{{#set: consumed by=1.14.19.3-RXN|RXN-16094|LINOLEOYL-RXN}}
+
−
{{#set: produced by=RXN-16045|RXN-9601|RXN-9673}}
+

Revision as of 13:39, 21 March 2018

Gene Ec-04_004690

  • left end position:
    • 4710646
  • transcription direction:
    • POSITIVE
  • right end position:
    • 4727401
  • centisome position:
    • 72.339584
  • Synonym(s):
    • Esi_0037_0140
    • Esi0037_0140

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-15044&oldid=20462"