Difference between revisions of "Ec-25 001860"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROPHOSPHOGLYCEROL GLYCEROPHOSPHOGLYCEROL] == * smiles: ** C(C(COP(OCC(CO)O)([O-])=O)O)O *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-galactopyranose D-galactopyranose] == * common name: ** D-galactopyranose * Synonym(s): == R...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-galactopyranose D-galactopyranose] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** D-galactopyranose |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[ALPHAGALACTOSID-RXN]] | ||
| + | * [[3.2.1.23-RXN]] | ||
| + | * [[RXN-12398]] | ||
| + | * [[RXN-12400]] | ||
| + | * [[RXN-12399]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-14409]] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=D-galactopyranose}} | |
| − | + | {{#set: produced by=ALPHAGALACTOSID-RXN|3.2.1.23-RXN|RXN-12398|RXN-12400|RXN-12399}} | |
| − | + | {{#set: reversible reaction associated=RXN-14409}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
Revision as of 13:39, 21 March 2018
Contents
Metabolite D-galactopyranose
- common name:
- D-galactopyranose
- Synonym(s):
