Difference between revisions of "Ec-12 004580"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7649 CPD-7649] == * smiles: ** C1(=C(CC[N+])C=C(OS(=O)(=O)[O-])C(O)=C1) * inchi key: ** InC...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10981 RXN-10981] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10981 RXN-10981] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 2 [[ASCORBATE]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[Acceptor]][c] '''=>''' 2 [[CPD-318]][c] '''+''' 1 [[Donor-H2]][c] |
− | == | + | * With common name(s): |
+ | ** 2 L-ascorbate[c] '''+''' 2 H+[c] '''+''' 1 an oxidized unknown electron acceptor[c] '''=>''' 2 monodehydroascorbate radical[c] '''+''' 1 an reduced unknown electron acceptor[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | * [[PWY-6370]], ascorbate recycling (cytosolic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6370 PWY-6370] | ||
+ | ** '''4''' reactions found over '''6''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * LIGAND- | + | * LIGAND-RXN: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00645 R00645] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: in pathway=PWY-6370}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 20:41, 17 March 2018
Contents
Reaction RXN-10981
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 2 L-ascorbate[c] + 2 H+[c] + 1 an oxidized unknown electron acceptor[c] => 2 monodehydroascorbate radical[c] + 1 an reduced unknown electron acceptor[c]
Genes associated with this reaction
Pathways
- PWY-6370, ascorbate recycling (cytosolic): PWY-6370
- 4 reactions found over 6 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- LIGAND-RXN: