Difference between revisions of "2.5.1.58-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10806 CPD-10806] == * smiles: ** CCCCCC(O)[CH]=CC=O * inchi key: ** InChIKey=JVJFIQYAHPMBBX...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18490 CPD-18490] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18490 CPD-18490] == |
* smiles: | * smiles: | ||
− | ** CCCCCC(O)[ | + | ** CCCCCC=CCC=CCC=CCC=CCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=AVRCOFDAWHWKMB-MNTHWFIHSA-J |
* common name: | * common name: | ||
− | ** | + | ** (2E,9Z,12Z,15Z,18Z)-tetracosa-2,9,12,15,18-pentaenoyl-CoA |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 1104.05 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** (2E,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-17111]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-17110]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: smiles=CCCCCC=CCC=CCC=CCC=CCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}} | |
− | + | {{#set: inchi key=InChIKey=AVRCOFDAWHWKMB-MNTHWFIHSA-J}} | |
− | + | {{#set: common name=(2E,9Z,12Z,15Z,18Z)-tetracosa-2,9,12,15,18-pentaenoyl-CoA}} | |
− | + | {{#set: molecular weight=1104.05 }} | |
− | + | {{#set: common name=(2E,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA}} | |
− | + | {{#set: consumed by=RXN-17111}} | |
− | + | {{#set: produced by=RXN-17110}} | |
− | + | ||
− | {{#set: smiles=CCCCCC(O)[ | + | |
− | {{#set: inchi key=InChIKey= | + | |
− | {{#set: common name= | + | |
− | {{#set: molecular weight= | + | |
− | {{#set: common name= | + | |
− | {{#set: consumed by=RXN- | + |
Revision as of 14:39, 21 March 2018
Contents
Metabolite CPD-18490
- smiles:
- CCCCCC=CCC=CCC=CCC=CCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
- inchi key:
- InChIKey=AVRCOFDAWHWKMB-MNTHWFIHSA-J
- common name:
- (2E,9Z,12Z,15Z,18Z)-tetracosa-2,9,12,15,18-pentaenoyl-CoA
- molecular weight:
- 1104.05
- Synonym(s):
- (2E,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC=CCC=CCC=CCC=CCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.