Difference between revisions of "GLY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHURENATE XANTHURENATE] == * smiles: ** C1(=CC2(=C(C(O)=C1)N=C(C=C([O-])2)C(=O)[O-])) * inch...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACYLCOADEHYDROG-RXN ACYLCOADEHYDROG-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** acyl-Co...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACYLCOADEHYDROG-RXN ACYLCOADEHYDROG-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** acyl-CoA dehydrogenase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.3.8 EC-1.3.8] |
* Synonym(s): | * Synonym(s): | ||
+ | ** fatty acyl coenzyme A dehydrogenase | ||
+ | ** acyl coenzyme A dehydrogenase | ||
+ | ** fatty-acyl-CoA dehydrogenase | ||
+ | ** general acyl CoA dehydrogenase | ||
+ | ** medium-chain acyl-coenzyme A dehydrogenase | ||
+ | ** long-chain acyl coenzyme A dehydrogenase | ||
+ | ** long-chain acyl-CoA dehydrogenase | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[Saturated-Fatty-Acyl-CoA]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ETF-Oxidized]][c] '''=>''' 1 [[ETF-Reduced]][c] '''+''' 1 [[TRANS-D2-ENOYL-COA]][c] |
− | == | + | * With common name(s): |
+ | ** 1 a 2,3,4-saturated fatty acyl CoA[c] '''+''' 1 H+[c] '''+''' 1 an oxidized electron-transfer flavoprotein[c] '''=>''' 1 a reduced electron-transfer flavoprotein[c] '''+''' 1 a trans-2-enoyl-CoA[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-06_008910]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-14_001600]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-08_006390]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-21_001100]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-16_004260]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-03_003490]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | == Pathways == | ||
+ | * [[FAO-PWY]], fatty acid β-oxidation I: [http://metacyc.org/META/NEW-IMAGE?object=FAO-PWY FAO-PWY] | ||
+ | ** '''5''' reactions found over '''7''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * UNIPROT: |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P16219 P16219] |
− | * | + | ** [http://www.uniprot.org/uniprot/P45952 P45952] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P15651 P15651] |
− | * | + | ** [http://www.uniprot.org/uniprot/P11310 P11310] |
− | * | + | ** [http://www.uniprot.org/uniprot/P08503 P08503] |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/Q07417 Q07417] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q54857 Q54857] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P45867 P45867] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9X3R3 Q9X3R3] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9R9I6 Q9R9I6] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q96329 Q96329] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
+ | {{#set: common name=acyl-CoA dehydrogenase}} | ||
+ | {{#set: ec number=EC-1.3.8}} | ||
+ | {{#set: common name=fatty acyl coenzyme A dehydrogenase|acyl coenzyme A dehydrogenase|fatty-acyl-CoA dehydrogenase|general acyl CoA dehydrogenase|medium-chain acyl-coenzyme A dehydrogenase|long-chain acyl coenzyme A dehydrogenase|long-chain acyl-CoA dehydrogenase}} | ||
+ | {{#set: gene associated=Ec-06_008910|Ec-14_001600|Ec-08_006390|Ec-21_001100|Ec-16_004260|Ec-03_003490}} | ||
+ | {{#set: in pathway=FAO-PWY}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Revision as of 13:40, 21 March 2018
Contents
Reaction ACYLCOADEHYDROG-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- acyl-CoA dehydrogenase
- ec number:
- Synonym(s):
- fatty acyl coenzyme A dehydrogenase
- acyl coenzyme A dehydrogenase
- fatty-acyl-CoA dehydrogenase
- general acyl CoA dehydrogenase
- medium-chain acyl-coenzyme A dehydrogenase
- long-chain acyl coenzyme A dehydrogenase
- long-chain acyl-CoA dehydrogenase
Reaction Formula
- With identifiers:
- 1 Saturated-Fatty-Acyl-CoA[c] + 1 PROTON[c] + 1 ETF-Oxidized[c] => 1 ETF-Reduced[c] + 1 TRANS-D2-ENOYL-COA[c]
- With common name(s):
- 1 a 2,3,4-saturated fatty acyl CoA[c] + 1 H+[c] + 1 an oxidized electron-transfer flavoprotein[c] => 1 a reduced electron-transfer flavoprotein[c] + 1 a trans-2-enoyl-CoA[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-06_008910
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-14_001600
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-08_006390
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-21_001100
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-16_004260
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-03_003490
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links