Difference between revisions of "Ec-22 000860"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-06_010400 == * left end position: ** 8105482 * transcription direction: ** NEGATIVE * right end position: ** 8108874 * centisome position: ** 92.5...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14704 CPD-14704] == * smiles: ** CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-06_010400 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14704 CPD-14704] ==
−
* left end position:
+
* smiles:
−
** 8105482
+
** CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=NOKRNJLENDLSKM-UHFFFAOYSA-M
−
* right end position:
+
* common name:
−
** 8108874
+
** 4-hydroxy-2-nonenal-glutathione conjugate
−
* centisome position:
+
* molecular weight:
−
** 92.55202    
+
** 462.537    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0136_0046
 
−
** Esi0136_0046
 
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[3.6.3.6-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** esiliculosus_genome
+
* [[RXN-13673]]
−
***automated-name-match
+
== Reaction(s) of unknown directionality ==
−
* [[ATPASE-RXN]]
+
−
** [[pantograph]]-[[aragem]]
+
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=8105482}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657725 90657725]
−
{{#set: right end position=8108874}}
+
{{#set: smiles=CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O}}
−
{{#set: centisome position=92.55202    }}
+
{{#set: inchi key=InChIKey=NOKRNJLENDLSKM-UHFFFAOYSA-M}}
−
{{#set: common name=Esi_0136_0046|Esi0136_0046}}
+
{{#set: common name=4-hydroxy-2-nonenal-glutathione conjugate}}
−
{{#set: reaction associated=3.6.3.6-RXN|ATPASE-RXN}}
+
{{#set: molecular weight=462.537    }}
 +
{{#set: produced by=RXN-13673}}

Revision as of 13:40, 21 March 2018

Metabolite CPD-14704

  • smiles:
    • CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O
  • inchi key:
    • InChIKey=NOKRNJLENDLSKM-UHFFFAOYSA-M
  • common name:
    • 4-hydroxy-2-nonenal-glutathione conjugate
  • molecular weight:
    • 462.537
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-22_000860&oldid=20670"