Difference between revisions of "RXN-14971"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE TREHALOSE] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))O * inchi ke...") |
(Created page with "Category:Gene == Gene Ec-13_002530 == * left end position: ** 4181090 * transcription direction: ** NEGATIVE * right end position: ** 4193679 * centisome position: ** 60.2...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-13_002530 == |
− | * | + | * left end position: |
− | ** | + | ** 4181090 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 4193679 |
− | * | + | * centisome position: |
− | ** | + | ** 60.27868 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0330_0001 |
− | ** | + | ** Esi0330_0001 |
− | ** | + | ** AK1 |
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[ASPARTATEKIN-RXN]] |
− | == | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: ec-number |
− | + | == Pathways associated == | |
+ | * [[HOMOSERSYN-PWY]] | ||
+ | * [[PWY-7153]] | ||
+ | * [[DAPLYSINESYN-PWY]] | ||
+ | * [[PWY-2942]] | ||
+ | * [[PWY-2941]] | ||
+ | * [[PWY-6559]] | ||
+ | * [[PWY-6562]] | ||
+ | * [[PWY-5097]] | ||
+ | * [[P101-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4181090}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=4193679}} | |
− | + | {{#set: centisome position=60.27868 }} | |
− | + | {{#set: common name=Esi_0330_0001|Esi0330_0001|AK1}} | |
− | + | {{#set: reaction associated=ASPARTATEKIN-RXN}} | |
− | + | {{#set: pathway associated=HOMOSERSYN-PWY|PWY-7153|DAPLYSINESYN-PWY|PWY-2942|PWY-2941|PWY-6559|PWY-6562|PWY-5097|P101-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 13:41, 21 March 2018
Gene Ec-13_002530
- left end position:
- 4181090
- transcription direction:
- NEGATIVE
- right end position:
- 4193679
- centisome position:
- 60.27868
- Synonym(s):
- Esi_0330_0001
- Esi0330_0001
- AK1
Reactions associated
- Reaction: ASPARTATEKIN-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome