Difference between revisions of "RXN-14177"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7003 CPD-7003] == * smiles: ** CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C *...") |
(Created page with "Category:Gene == Gene Ec-12_008160 == * left end position: ** 7292135 * transcription direction: ** NEGATIVE * right end position: ** 7301992 * centisome position: ** 87.4...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-12_008160 == |
− | * | + | * left end position: |
− | ** | + | ** 7292135 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 7301992 |
− | * | + | * centisome position: |
− | ** | + | ** 87.47708 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0130_0065 |
− | ** | + | ** Esi0130_0065 |
− | + | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[MONOPHENOL-MONOOXYGENASE-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[RXN- | + | *** Assignment: ec-number |
− | == | + | * Reaction: [[RXN-13061]] |
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-5861]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6955]] | ||
+ | * [[PWY-6133]] | ||
+ | * [[PWY-6481]] | ||
+ | * [[PWY-3581]] | ||
+ | * [[PWY-5399]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=7292135}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | {{#set: | + | {{#set: right end position=7301992}} |
− | {{#set: | + | {{#set: centisome position=87.47708 }} |
− | {{#set: | + | {{#set: common name=Esi_0130_0065|Esi0130_0065}} |
− | {{#set: | + | {{#set: reaction associated=MONOPHENOL-MONOOXYGENASE-RXN|RXN-13061|RXN-5861}} |
− | {{#set: common name= | + | {{#set: pathway associated=PWY-6955|PWY-6133|PWY-6481|PWY-3581|PWY-5399}} |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 14:41, 21 March 2018
Gene Ec-12_008160
- left end position:
- 7292135
- transcription direction:
- NEGATIVE
- right end position:
- 7301992
- centisome position:
- 87.47708
- Synonym(s):
- Esi_0130_0065
- Esi0130_0065
Reactions associated
- Reaction: MONOPHENOL-MONOOXYGENASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-13061
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-5861
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome