Difference between revisions of "RXN-14177"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7003 CPD-7003] == * smiles: ** CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C *...")
(Created page with "Category:Gene == Gene Ec-12_008160 == * left end position: ** 7292135 * transcription direction: ** NEGATIVE * right end position: ** 7301992 * centisome position: ** 87.4...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7003 CPD-7003] ==
+
== Gene Ec-12_008160 ==
−
* smiles:
+
* left end position:
−
** CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
+
** 7292135
−
* inchi key:
+
* transcription direction:
−
** InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** tetrahydrogeranylgeranyl diphosphate
+
** 7301992
−
* molecular weight:
+
* centisome position:
−
** 451.456    
+
** 87.47708    
 
* Synonym(s):
 
* Synonym(s):
−
** tetrahydroGGPP
+
** Esi_0130_0065
−
** tetrahydrogeranylgeranyl pyrophosphate
+
** Esi0130_0065
−
** tetrahydrogeranylgeranyl-PP
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-7660]]
+
* Reaction: [[MONOPHENOL-MONOOXYGENASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-7659]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-13061]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-5861]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-6955]]
 +
* [[PWY-6133]]
 +
* [[PWY-6481]]
 +
* [[PWY-3581]]
 +
* [[PWY-5399]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=7292135}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657275 90657275]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C}}
+
{{#set: right end position=7301992}}
−
{{#set: inchi key=InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K}}
+
{{#set: centisome position=87.47708   }}
−
{{#set: common name=tetrahydrogeranylgeranyl diphosphate}}
+
{{#set: common name=Esi_0130_0065|Esi0130_0065}}
−
{{#set: molecular weight=451.456   }}
+
{{#set: reaction associated=MONOPHENOL-MONOOXYGENASE-RXN|RXN-13061|RXN-5861}}
−
{{#set: common name=tetrahydroGGPP|tetrahydrogeranylgeranyl pyrophosphate|tetrahydrogeranylgeranyl-PP}}
+
{{#set: pathway associated=PWY-6955|PWY-6133|PWY-6481|PWY-3581|PWY-5399}}
−
{{#set: consumed by=RXN-7660}}
+
−
{{#set: produced by=RXN-7659}}
+

Revision as of 13:41, 21 March 2018

Gene Ec-12_008160

  • left end position:
    • 7292135
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 7301992
  • centisome position:
    • 87.47708
  • Synonym(s):
    • Esi_0130_0065
    • Esi0130_0065

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-14177&oldid=20749"