Difference between revisions of "TRNA-pseudouridine-38-40"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-804 CPD-804] == * smiles: ** C(CCC(O)CC(C([O-])=O)=O)([O-])=O * inchi key: ** InChIKey=HNOA...") |
(Created page with "Category:Gene == Gene Ec-00_006580 == * left end position: ** 10455943 * transcription direction: ** POSITIVE * right end position: ** 10458685 * centisome position: ** 55...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-00_006580 == |
− | * | + | * left end position: |
− | ** | + | ** 10455943 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 10458685 |
− | * | + | * centisome position: |
− | ** | + | ** 55.186874 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0509_0009 |
− | ** | + | ** Esi0509_0009 |
− | ** | + | ** GPX |
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[GLUTATHIONE-PEROXIDASE-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: ec-number |
+ | == Pathways associated == | ||
+ | * [[DETOX1-PWY-1]] | ||
+ | * [[PWY-4081]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=10455943}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=10458685}} | |
− | + | {{#set: centisome position=55.186874 }} | |
− | + | {{#set: common name=Esi_0509_0009|Esi0509_0009|GPX}} | |
− | + | {{#set: reaction associated=GLUTATHIONE-PEROXIDASE-RXN}} | |
− | + | {{#set: pathway associated=DETOX1-PWY-1|PWY-4081}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 13:41, 21 March 2018
Gene Ec-00_006580
- left end position:
- 10455943
- transcription direction:
- POSITIVE
- right end position:
- 10458685
- centisome position:
- 55.186874
- Synonym(s):
- Esi_0509_0009
- Esi0509_0009
- GPX
Reactions associated
- Reaction: GLUTATHIONE-PEROXIDASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome