Difference between revisions of "Ec-15 002910"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGTP DGTP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14177 RXN-14177] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGTP DGTP] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14177 RXN-14177] ==
−
* smiles:
+
* direction:
−
** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=HAAZLUGHYHWQIW-KVQBGUIXSA-J
+
** [http://enzyme.expasy.org/EC/2.1.1.163 EC-2.1.1.163]
−
* common name:
+
−
** dGTP
+
−
* molecular weight:
+
−
** 503.152   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2'-deoxyguanosine-5'-triphosphate
 
−
** deoxy-GTP
 
−
** deoxyguanosine-triphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-14217]]
+
* With identifiers:
−
* [[RXN-14208]]
+
** 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[CPD-15152]][c] '''=>''' 1 [[CPD-15153]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c]
−
* [[RXN0-385]]
+
* With common name(s):
−
* [[RXN-11410]]
+
** 1 S-adenosyl-L-methionine[c] '''+''' 1 6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone[c] '''=>''' 1 3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone[c] '''+''' 1 H+[c] '''+''' 1 S-adenosyl-L-homocysteine[c]
−
== Reaction(s) known to produce the compound ==
+
 
−
* [[RXN0-746]]
+
== Genes associated with this reaction  ==
−
* [[DGDPKIN-RXN]]
+
Genes have been associated with this reaction based on different elements listed below.
−
== Reaction(s) of unknown directionality ==
+
* Gene: [[Ec-27_000650]]
−
* [[RXN-14207]]
+
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-16_000550]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-17_000350]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-27_005280]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-06_002620]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-08_006620]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-09_002660]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 2564-35-4
+
* RHEA:
−
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=26465 26465]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246112 25246112]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* HMDB : HMDB01440
+
{{#set: ec number=EC-2.1.1.163}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Ec-27_000650|Ec-16_000550|Ec-17_000350|Ec-27_005280|Ec-06_002620|Ec-08_006620|Ec-09_002660}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00286 C00286]
+
{{#set: in pathway=}}
−
* CHEBI:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61429 61429]
+
{{#set: reconstruction source=orthology-aragem}}
−
* BIGG : 34502
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}}
+
−
{{#set: inchi key=InChIKey=HAAZLUGHYHWQIW-KVQBGUIXSA-J}}
+
−
{{#set: common name=dGTP}}
+
−
{{#set: molecular weight=503.152    }}
+
−
{{#set: common name=2'-deoxyguanosine-5'-triphosphate|deoxy-GTP|deoxyguanosine-triphosphate}}
+
−
{{#set: consumed by=RXN-14217|RXN-14208|RXN0-385|RXN-11410}}
+
−
{{#set: produced by=RXN0-746|DGDPKIN-RXN}}
+
−
{{#set: reversible reaction associated=RXN-14207}}
+

Revision as of 13:41, 21 March 2018

Reaction RXN-14177

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 S-adenosyl-L-methionine[c] + 1 6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone[c] => 1 3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone[c] + 1 H+[c] + 1 S-adenosyl-L-homocysteine[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-15_002910&oldid=20825"