Difference between revisions of "HOLO-ACP-SYNTH-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-01_000130 == * left end position: ** 79243 * transcription direction: ** NEGATIVE * right end position: ** 82180 * centisome position: ** 0.767945...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5821 CPD-5821] == * smiles: ** C(C1(O)(NC(=O)N=C1NC(N)=O))(=O)[O-] * inchi key: ** InChIKey...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-01_000130 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5821 CPD-5821] ==
−
* left end position:
+
* smiles:
−
** 79243
+
** C(C1(O)(NC(=O)N=C1NC(N)=O))(=O)[O-]
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=WHKYNCPIXMNTRQ-UHFFFAOYSA-M
−
* right end position:
+
* common name:
−
** 82180
+
** 2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline
−
* centisome position:
+
* molecular weight:
−
** 0.7679453    
+
** 201.118    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0207_0018
+
** 5-hydroxy-2-oxo-4-ureido-2,5-dihydro-1H imidazole-5-carboxylate
−
** Esi0207_0018
+
** OHCU
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[ENTDB-RXN]]
+
* [[RXN-6201]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***go-term
+
* [[3.5.2.17-RXN]]
−
* [[HOLO-ACP-SYNTH-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** esiliculosus_genome
+
−
***go-term
+
−
* [[RXN-10994]]
+
−
** esiliculosus_genome
+
−
***go-term
+
−
* [[RXN-15889]]
+
−
** esiliculosus_genome
+
−
***go-term
+
−
* [[RXN-16759]]
+
−
** esiliculosus_genome
+
−
***go-term
+
−
== Pathways associated ==
+
−
* [[ENTBACSYN-PWY]]
+
−
* [[PWY-6012]]
+
−
* [[PWY-6012-1]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=79243}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21145222 21145222]
−
{{#set: right end position=82180}}
+
* CHEMSPIDER:
−
{{#set: centisome position=0.7679453   }}
+
** [http://www.chemspider.com/Chemical-Structure.20016217.html 20016217]
−
{{#set: common name=Esi_0207_0018|Esi0207_0018}}
+
* CHEBI:
−
{{#set: reaction associated=ENTDB-RXN|HOLO-ACP-SYNTH-RXN|RXN-10994|RXN-15889|RXN-16759}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58639 58639]
−
{{#set: pathway associated=ENTBACSYN-PWY|PWY-6012|PWY-6012-1}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C12248 C12248]
 +
* HMDB : HMDB59663
 +
{{#set: smiles=C(C1(O)(NC(=O)N=C1NC(N)=O))(=O)[O-]}}
 +
{{#set: inchi key=InChIKey=WHKYNCPIXMNTRQ-UHFFFAOYSA-M}}
 +
{{#set: common name=2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline}}
 +
{{#set: molecular weight=201.118   }}
 +
{{#set: common name=5-hydroxy-2-oxo-4-ureido-2,5-dihydro-1H imidazole-5-carboxylate|OHCU}}
 +
{{#set: consumed by=RXN-6201}}
 +
{{#set: produced by=3.5.2.17-RXN}}

Revision as of 13:42, 21 March 2018

Metabolite CPD-5821

  • smiles:
    • C(C1(O)(NC(=O)N=C1NC(N)=O))(=O)[O-]
  • inchi key:
    • InChIKey=WHKYNCPIXMNTRQ-UHFFFAOYSA-M
  • common name:
    • 2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline
  • molecular weight:
    • 201.118
  • Synonym(s):
    • 5-hydroxy-2-oxo-4-ureido-2,5-dihydro-1H imidazole-5-carboxylate
    • OHCU

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C1(O)(NC(=O)N=C1NC(N)=O))(=O)[O-" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=HOLO-ACP-SYNTH-RXN&oldid=20951"