Difference between revisions of "Ec-27 005710"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRU1P FRU1P] == * smiles: ** C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1) * inchi key: ** InChIKey...") |
(Created page with "Category:Gene == Gene Ec-01_007170 == * Synonym(s): ** Esi_0002_0203 ** Esi0002_0203 == Reactions associated == * Reaction: ADCLY-RXN ** Source: orthology-aragem...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Ec-01_007170 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** Esi_0002_0203 |
| + | ** Esi0002_0203 | ||
| − | == | + | == Reactions associated == |
| − | * [[RXN- | + | * Reaction: [[ADCLY-RXN]] |
| − | + | ** Source: [[orthology-aragem]] | |
| − | == | + | * Reaction: [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]] |
| + | ** Source: [[orthology-aragem]] | ||
| + | == Pathways associated == | ||
| + | * [[ILEUSYN-PWY]] | ||
| + | * [[ILEUDEG-PWY]] | ||
| + | * [[PWY-5108]] | ||
| + | * [[PWY-5103]] | ||
| + | * [[PWY-5101]] | ||
| + | * [[PWY-5078]] | ||
| + | * [[PWY-6543]] | ||
| + | * [[PWY-5104]] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=Esi_0002_0203|Esi0002_0203}} | |
| − | + | {{#set: reaction associated=ADCLY-RXN|BRANCHED-CHAINAMINOTRANSFERILEU-RXN}} | |
| − | + | {{#set: pathway associated=ILEUSYN-PWY|ILEUDEG-PWY|PWY-5108|PWY-5103|PWY-5101|PWY-5078|PWY-6543|PWY-5104}} | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
Revision as of 13:42, 21 March 2018
Gene Ec-01_007170
- Synonym(s):
- Esi_0002_0203
- Esi0002_0203
Reactions associated
- Reaction: ADCLY-RXN
- Source: orthology-aragem
- Reaction: BRANCHED-CHAINAMINOTRANSFERILEU-RXN
- Source: orthology-aragem
