Difference between revisions of "COBALADENOSYLTRANS-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12724 CPD-12724] == * smiles: ** C1(C=CC(=CC=1)C2(=CC(=O)C3(=C(O2)C=C(O)C(O)=C(O)3))) * inc...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-332 CPD1G-332] == * smiles: ** CCCCCCCCCCCCCCCCCCCCCCCCC(C([O-])=O)C(SCCNC(=O)CCNC(=O)C(O...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-332 CPD1G-332] == |
* smiles: | * smiles: | ||
− | ** | + | ** CCCCCCCCCCCCCCCCCCCCCCCCC(C([O-])=O)C(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=VUYDEKMWDHLSSI-RVNPWDOLSA-I |
* common name: | * common name: | ||
− | ** | + | ** 2-carboxy-cerotoyl-CoA |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 1185.185 |
* Synonym(s): | * Synonym(s): | ||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN1G-4355]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173201 46173201] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83578 83578] |
− | + | {{#set: smiles=CCCCCCCCCCCCCCCCCCCCCCCCC(C([O-])=O)C(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}} | |
− | {{#set: smiles= | + | {{#set: inchi key=InChIKey=VUYDEKMWDHLSSI-RVNPWDOLSA-I}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: common name=2-carboxy-cerotoyl-CoA}} |
− | {{#set: common name= | + | {{#set: molecular weight=1185.185 }} |
− | {{#set: molecular weight= | + | {{#set: produced by=RXN1G-4355}} |
− | {{#set: | + | |
− | + |
Revision as of 13:43, 21 March 2018
Contents
Metabolite CPD1G-332
- smiles:
- CCCCCCCCCCCCCCCCCCCCCCCCC(C([O-])=O)C(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
- inchi key:
- InChIKey=VUYDEKMWDHLSSI-RVNPWDOLSA-I
- common name:
- 2-carboxy-cerotoyl-CoA
- molecular weight:
- 1185.185
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCCCCCCCCCCCCCCCCCC(C([O-])=O)C(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.