Difference between revisions of "Ec-06 005060"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THZ-P THZ-P] == * smiles: ** CC1(N=CSC(CCOP([O-])(=O)[O-])=1) * inchi key: ** InChIKey=OCYMERZC...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17637 CPD-17637] == * smiles: ** CCCCCC(O)CCCCCC([O-])=O * inchi key: ** InChIKey=BNWKMHUFF...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17637 CPD-17637] == |
* smiles: | * smiles: | ||
− | ** | + | ** CCCCCC(O)CCCCCC([O-])=O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=BNWKMHUFFKDAMV-UHFFFAOYSA-M |
* common name: | * common name: | ||
− | ** | + | ** 7-hydroxylaurate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 215.312 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 7-hydroxydodecanoic acid |
− | ** | + | ** 7-hydroxylauric acid |
− | + | ** 7-hydroxydodecanoate | |
− | + | ||
− | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-12184]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659904 90659904] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84921 84921] |
− | + | {{#set: smiles=CCCCCC(O)CCCCCC([O-])=O}} | |
− | + | {{#set: inchi key=InChIKey=BNWKMHUFFKDAMV-UHFFFAOYSA-M}} | |
− | + | {{#set: common name=7-hydroxylaurate}} | |
− | {{#set: smiles= | + | {{#set: molecular weight=215.312 }} |
− | {{#set: inchi key=InChIKey= | + | {{#set: common name=7-hydroxydodecanoic acid|7-hydroxylauric acid|7-hydroxydodecanoate}} |
− | {{#set: common name= | + | {{#set: consumed by=RXN-12184}} |
− | {{#set: molecular weight= | + | |
− | {{#set: common name= | + | |
− | {{#set: consumed by= | + | |
− | + |
Revision as of 13:43, 21 March 2018
Contents
Metabolite CPD-17637
- smiles:
- CCCCCC(O)CCCCCC([O-])=O
- inchi key:
- InChIKey=BNWKMHUFFKDAMV-UHFFFAOYSA-M
- common name:
- 7-hydroxylaurate
- molecular weight:
- 215.312
- Synonym(s):
- 7-hydroxydodecanoic acid
- 7-hydroxylauric acid
- 7-hydroxydodecanoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC(O)CCCCCC([O-])=O" cannot be used as a page name in this wiki.